C11H18O3 — CID 102376963
methyl (2S)-2-hydroxy-3,6,6-trimethylhepta-3,4-dienoate (PubChem CID 102376963) has the molecular formula C11H18O3 and a molecular weight of 198.26 g/mol. Its IUPAC name is methyl (2S)-2-hydroxy-3,6,6-trimethylhepta-3,4-dienoate.
| Compound Name | methyl (2S)-2-hydroxy-3,6,6-trimethylhepta-3,4-dienoate |
|---|---|
| PubChem CID | 102376963 |
| Molecular Formula | C11H18O3 |
| Molecular Weight | 198.26 g/mol |
| Exact Mass | 198.13 |
| IUPAC Name | methyl (2S)-2-hydroxy-3,6,6-trimethylhepta-3,4-dienoate |
| SMILES | COC(=O)[C@@H](O)C(C)=C=CC(C)(C)C |
| InChI | InChI=1S/C11H18O3/c1-8(6-7-11(2,3)4)9(12)10(13)14-5/h7,9,12H,1-5H3/t6?,9-/m0/s1 |
| InChIKey | DIDFJKIZZAXBOA-HSOSERFQSA-N |
| XLogP | 1.67 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 198.26 |
| LogP ≤ 5 | 1.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |