C16H32O2Si — CID 102376965
(2S)-1-[tert-butyl(dimethyl)silyl]oxy-3,6,6-trimethylhepta-3,4-dien-2-ol (PubChem CID 102376965) has the molecular formula C16H32O2Si and a molecular weight of 284.52 g/mol. Its IUPAC name is (2S)-1-[tert-butyl(dimethyl)silyl]oxy-3,6,6-trimethylhepta-3,4-dien-2-ol.
| Compound Name | (2S)-1-[tert-butyl(dimethyl)silyl]oxy-3,6,6-trimethylhepta-3,4-dien-2-ol |
|---|---|
| PubChem CID | 102376965 |
| Molecular Formula | C16H32O2Si |
| Molecular Weight | 284.52 g/mol |
| Exact Mass | 284.22 |
| IUPAC Name | (2S)-1-[tert-butyl(dimethyl)silyl]oxy-3,6,6-trimethylhepta-3,4-dien-2-ol |
| SMILES | CC(=C=CC(C)(C)C)[C@H](O)CO[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C16H32O2Si/c1-13(10-11-15(2,3)4)14(17)12-18-19(8,9)16(5,6)7/h11,14,17H,12H2,1-9H3/t10?,14-/m1/s1 |
| InChIKey | SBVZSFGBSWOJCA-LNUXAPHWSA-N |
| XLogP | 4.52 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.52 |
| LogP ≤ 5 | 4.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|