C12H22O2 — CID 102376968
(2S)-1-methoxy-3,5,6,6-tetramethylhepta-3,4-dien-2-ol (PubChem CID 102376968) has the molecular formula C12H22O2 and a molecular weight of 198.31 g/mol. Its IUPAC name is (2S)-1-methoxy-3,5,6,6-tetramethylhepta-3,4-dien-2-ol.
| Compound Name | (2S)-1-methoxy-3,5,6,6-tetramethylhepta-3,4-dien-2-ol |
|---|---|
| PubChem CID | 102376968 |
| Molecular Formula | C12H22O2 |
| Molecular Weight | 198.31 g/mol |
| Exact Mass | 198.16 |
| IUPAC Name | (2S)-1-methoxy-3,5,6,6-tetramethylhepta-3,4-dien-2-ol |
| SMILES | COC[C@@H](O)C(C)=C=C(C)C(C)(C)C |
| InChI | InChI=1S/C12H22O2/c1-9(11(13)8-14-6)7-10(2)12(3,4)5/h11,13H,8H2,1-6H3/t7?,11-/m1/s1 |
| InChIKey | XWDVQNSTKZJUCZ-PLNQYNMKSA-N |
| XLogP | 2.53 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 198.31 |
| LogP ≤ 5 | 2.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |