About 2-methoxy-N-[(2S)-1,1,1-trifluoro-3-naphthalen-1-ylsulfinylpropan-2-yl]aniline
2-methoxy-N-[(2S)-1,1,1-trifluoro-3-naphthalen-1-ylsulfinylpropan-2-yl]aniline (PubChem CID 102377480) has the molecular formula C20H18F3NO2S
and a molecular weight of 393.43 g/mol. Its IUPAC name is 2-methoxy-N-[(2S)-1,1,1-trifluoro-3-naphthalen-1-ylsulfinylpropan-2-yl]aniline.
Molecular Properties
| Compound Name | 2-methoxy-N-[(2S)-1,1,1-trifluoro-3-naphthalen-1-ylsulfinylpropan-2-yl]aniline |
| PubChem CID | 102377480 |
| Molecular Formula | C20H18F3NO2S |
| Molecular Weight | 393.43 g/mol |
| Exact Mass | 393.10 |
| IUPAC Name | 2-methoxy-N-[(2S)-1,1,1-trifluoro-3-naphthalen-1-ylsulfinylpropan-2-yl]aniline |
| SMILES | COc1ccccc1N[C@H](CS(=O)c1cccc2ccccc12)C(F)(F)F |
| InChI | InChI=1S/C20H18F3NO2S/c1-26-17-11-5-4-10-16(17)24-19(20(21,22)23)13-27(25)18-12-6-8-14-7-2-3-9-15(14)18/h2-12,19,24H,13H2,1H3/t19-,27?/m1/s1 |
| InChIKey | AWTYBJIIKKFDCU-FOEZPWHWSA-N |
| XLogP | 5.00 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 393.43 |
| LogP ≤ 5 | 5.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 2-methoxy-N-[(2S)-1,1,1-trifluoro-3-naphthalen-1-ylsulfinylpropan-2-yl]aniline with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-methoxy-N-[(2S)-1,1,1-trifluoro-3-naphthalen-1-ylsulfinylpropan-2-yl]aniline?
The IUPAC name of 2-methoxy-N-[(2S)-1,1,1-trifluoro-3-naphthalen-1-ylsulfinylpropan-2-yl]aniline (CID 102377480) is 2-methoxy-N-[(2S)-1,1,1-trifluoro-3-naphthalen-1-ylsulfinylpropan-2-yl]aniline.
What is the SMILES notation for 2-methoxy-N-[(2S)-1,1,1-trifluoro-3-naphthalen-1-ylsulfinylpropan-2-yl]aniline?
The canonical SMILES for 2-methoxy-N-[(2S)-1,1,1-trifluoro-3-naphthalen-1-ylsulfinylpropan-2-yl]aniline is COc1ccccc1N[C@H](CS(=O)c1cccc2ccccc12)C(F)(F)F.
What is the InChIKey of 2-methoxy-N-[(2S)-1,1,1-trifluoro-3-naphthalen-1-ylsulfinylpropan-2-yl]aniline?
The InChIKey is AWTYBJIIKKFDCU-FOEZPWHWSA-N. The full InChI is InChI=1S/C20H18F3NO2S/c1-26-17-11-5-4-10-16(17)24-19(20(21,22)23)13-27(25)18-12-6-8-14-7-2-3-9-15(14)18/h2-12,19,24H,13H2,1H3/t19-,27?/m1/s1.
What are the key properties of 2-methoxy-N-[(2S)-1,1,1-trifluoro-3-naphthalen-1-ylsulfinylpropan-2-yl]aniline?
2-methoxy-N-[(2S)-1,1,1-trifluoro-3-naphthalen-1-ylsulfinylpropan-2-yl]aniline has a molecular weight of 393.43 g/mol, XLogP of 5.00, 6 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-methoxy-N-[(2S)-1,1,1-trifluoro-3-naphthalen-1-ylsulfinylpropan-2-yl]aniline is sourced from PubChem (CID 102377480), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).