C23H21ClN4O — CID 10237750
3-[(2S)-2-amino-3-({2-chloro-5-[(E)-2-(pyridin-4-yl)ethenyl]pyridin-3-yl}oxy)propyl]-1H-indole (PubChem CID 10237750) has the molecular formula C23H21ClN4O and a molecular weight of 404.90 g/mol. Its IUPAC name is (2S)-1-[[2-chloro-5-[(E)-2-pyridin-4-ylethenyl]-3-pyridinyl]oxy]-3-(1H-indol-3-yl)propan-2-amine.
| Compound Name | 3-[(2S)-2-amino-3-({2-chloro-5-[(E)-2-(pyridin-4-yl)ethenyl]pyridin-3-yl}oxy)propyl]-1H-indole |
|---|---|
| PubChem CID | 10237750 |
| Molecular Formula | C23H21ClN4O |
| Molecular Weight | 404.90 g/mol |
| Exact Mass | 404.14 |
| IUPAC Name | (2S)-1-[[2-chloro-5-[(E)-2-pyridin-4-ylethenyl]-3-pyridinyl]oxy]-3-(1H-indol-3-yl)propan-2-amine |
| SMILES | C1=CC=C2C(=C1)C(=CN2)C[C@@H](COC3=C(N=CC(=C3)/C=C/C4=CC=NC=C4)Cl)N |
| InChI | InChI=1S/C23H21ClN4O/c24-23-22(11-17(13-28-23)6-5-16-7-9-26-10-8-16)29-15-19(25)12-18-14-27-21-4-2-1-3-20(18)21/h1-11,13-14,19,27H,12,15,25H2/b6-5+/t19-/m0/s1 |
| InChIKey | AQDWLHMFJHACCX-UEKDZROGSA-N |
| XLogP | 4.20 |
| TPSA | 76.80 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | 527 |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.90 |
| LogP ≤ 5 | 4.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|