C14H19BrFNOSi — CID 102377626
[(4R,6S)-4-bromo-3-(4-fluorophenyl)-5,6-dihydro-4H-oxazin-6-yl]methyl-trimethylsilane (PubChem CID 102377626) has the molecular formula C14H19BrFNOSi and a molecular weight of 344.30 g/mol. Its IUPAC name is [(4R,6S)-4-bromo-3-(4-fluorophenyl)-5,6-dihydro-4H-oxazin-6-yl]methyl-trimethylsilane.
| Compound Name | [(4R,6S)-4-bromo-3-(4-fluorophenyl)-5,6-dihydro-4H-oxazin-6-yl]methyl-trimethylsilane |
|---|---|
| PubChem CID | 102377626 |
| Molecular Formula | C14H19BrFNOSi |
| Molecular Weight | 344.30 g/mol |
| Exact Mass | 343.04 |
| IUPAC Name | [(4R,6S)-4-bromo-3-(4-fluorophenyl)-5,6-dihydro-4H-oxazin-6-yl]methyl-trimethylsilane |
| SMILES | C[Si](C)(C)C[C@@H]1C[C@@H](Br)C(c2ccc(F)cc2)=NO1 |
| InChI | InChI=1S/C14H19BrFNOSi/c1-19(2,3)9-12-8-13(15)14(17-18-12)10-4-6-11(16)7-5-10/h4-7,12-13H,8-9H2,1-3H3/t12-,13+/m0/s1 |
| InChIKey | XZSBBNIQFZWUGJ-QWHCGFSZSA-N |
| XLogP | 4.42 |
| TPSA | 21.59 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.30 |
| LogP ≤ 5 | 4.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|