C20H32O6Si — CID 102377688
(2S,4aS,6R,7S,8R,8aR)-7-[tert-butyl(dimethyl)silyl]oxy-6-(hydroxymethyl)-2-phenyl-4,4a,6,7,8,8a-hexahydropyrano[3,2-d][1,3]dioxin-8-ol (PubChem CID 102377688) has the molecular formula C20H32O6Si and a molecular weight of 396.56 g/mol. Its IUPAC name is (2S,4aS,6R,7S,8R,8aR)-7-[tert-butyl(dimethyl)silyl]oxy-6-(hydroxymethyl)-2-phenyl-4,4a,6,7,8,8a-hexahydropyrano[3,2-d][1,3]dioxin-8-ol.
| Compound Name | (2S,4aS,6R,7S,8R,8aR)-7-[tert-butyl(dimethyl)silyl]oxy-6-(hydroxymethyl)-2-phenyl-4,4a,6,7,8,8a-hexahydropyrano[3,2-d][1,3]dioxin-8-ol |
|---|---|
| PubChem CID | 102377688 |
| Molecular Formula | C20H32O6Si |
| Molecular Weight | 396.56 g/mol |
| Exact Mass | 396.20 |
| IUPAC Name | (2S,4aS,6R,7S,8R,8aR)-7-[tert-butyl(dimethyl)silyl]oxy-6-(hydroxymethyl)-2-phenyl-4,4a,6,7,8,8a-hexahydropyrano[3,2-d][1,3]dioxin-8-ol |
| SMILES | CC(C)(C)[Si](C)(C)O[C@H]1[C@H](O)[C@H]2O[C@@H](c3ccccc3)OC[C@@H]2O[C@@H]1CO |
| InChI | InChI=1S/C20H32O6Si/c1-20(2,3)27(4,5)26-18-14(11-21)24-15-12-23-19(25-17(15)16(18)22)13-9-7-6-8-10-13/h6-10,14-19,21-22H,11-12H2,1-5H3/t14-,15+,16-,17+,18-,19+/m1/s1 |
| InChIKey | PNVVKRQSHGLYED-QWFUGVESSA-N |
| XLogP | 2.61 |
| TPSA | 77.38 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.56 |
| LogP ≤ 5 | 2.61 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|