C18H36O7Si — CID 102377694
[(2S,3S,4S,5S,6R)-4-[tert-butyl(dimethyl)silyl]oxy-5-hydroxy-2,6-bis(hydroxymethyl)oxan-3-yl] 2,2-dimethylpropanoate (PubChem CID 102377694) has the molecular formula C18H36O7Si and a molecular weight of 392.57 g/mol. Its IUPAC name is [(2S,3S,4S,5S,6R)-4-[tert-butyl(dimethyl)silyl]oxy-5-hydroxy-2,6-bis(hydroxymethyl)oxan-3-yl] 2,2-dimethylpropanoate.
| Compound Name | [(2S,3S,4S,5S,6R)-4-[tert-butyl(dimethyl)silyl]oxy-5-hydroxy-2,6-bis(hydroxymethyl)oxan-3-yl] 2,2-dimethylpropanoate |
|---|---|
| PubChem CID | 102377694 |
| Molecular Formula | C18H36O7Si |
| Molecular Weight | 392.57 g/mol |
| Exact Mass | 392.22 |
| IUPAC Name | [(2S,3S,4S,5S,6R)-4-[tert-butyl(dimethyl)silyl]oxy-5-hydroxy-2,6-bis(hydroxymethyl)oxan-3-yl] 2,2-dimethylpropanoate |
| SMILES | CC(C)(C)C(=O)O[C@@H]1[C@@H](O[Si](C)(C)C(C)(C)C)[C@@H](O)[C@@H](CO)O[C@H]1CO |
| InChI | InChI=1S/C18H36O7Si/c1-17(2,3)16(22)24-14-12(10-20)23-11(9-19)13(21)15(14)25-26(7,8)18(4,5)6/h11-15,19-21H,9-10H2,1-8H3/t11-,12+,13+,14+,15+/m1/s1 |
| InChIKey | OBCPITLPBUDBTA-QTVXIADOSA-N |
| XLogP | 1.45 |
| TPSA | 105.45 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.57 |
| LogP ≤ 5 | 1.45 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|