C24H28Cl2O6 — CID 102377700
2,9-bis(2-methoxyphenoxy)decanedioyl dichloride (PubChem CID 102377700) has the molecular formula C24H28Cl2O6 and a molecular weight of 483.39 g/mol. Its IUPAC name is 2,9-bis(2-methoxyphenoxy)decanedioyl dichloride.
| Compound Name | 2,9-bis(2-methoxyphenoxy)decanedioyl dichloride |
|---|---|
| PubChem CID | 102377700 |
| Molecular Formula | C24H28Cl2O6 |
| Molecular Weight | 483.39 g/mol |
| Exact Mass | 482.13 |
| IUPAC Name | 2,9-bis(2-methoxyphenoxy)decanedioyl dichloride |
| SMILES | COc1ccccc1OC(CCCCCCC(Oc1ccccc1OC)C(=O)Cl)C(=O)Cl |
| InChI | InChI=1S/C24H28Cl2O6/c1-29-17-11-7-9-13-19(17)31-21(23(25)27)15-5-3-4-6-16-22(24(26)28)32-20-14-10-8-12-18(20)30-2/h7-14,21-22H,3-6,15-16H2,1-2H3 |
| InChIKey | XSHJPJBDOWYIQJ-UHFFFAOYSA-N |
| XLogP | 5.77 |
| TPSA | 71.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 483.39 |
| LogP ≤ 5 | 5.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'acid_halide', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|