C16H26N2O5Si — CID 102378005
[(4aR,8R,8aS)-2,2-ditert-butyl-4,4a,8,8a-tetrahydropyrano[3,2-d][1,3,2]dioxasilin-8-yl] 2-diazoacetate (PubChem CID 102378005) has the molecular formula C16H26N2O5Si and a molecular weight of 354.48 g/mol. Its IUPAC name is [(4aR,8R,8aS)-2,2-ditert-butyl-4,4a,8,8a-tetrahydropyrano[3,2-d][1,3,2]dioxasilin-8-yl] 2-diazoacetate.
| Compound Name | [(4aR,8R,8aS)-2,2-ditert-butyl-4,4a,8,8a-tetrahydropyrano[3,2-d][1,3,2]dioxasilin-8-yl] 2-diazoacetate |
|---|---|
| PubChem CID | 102378005 |
| Molecular Formula | C16H26N2O5Si |
| Molecular Weight | 354.48 g/mol |
| Exact Mass | 354.16 |
| IUPAC Name | [(4aR,8R,8aS)-2,2-ditert-butyl-4,4a,8,8a-tetrahydropyrano[3,2-d][1,3,2]dioxasilin-8-yl] 2-diazoacetate |
| SMILES | CC(C)(C)[Si]1(C(C)(C)C)OC[C@H]2OC=C[C@@H](OC(=O)C=[N+]=[N-])[C@@H]2O1 |
| InChI | InChI=1S/C16H26N2O5Si/c1-15(2,3)24(16(4,5)6)21-10-12-14(23-24)11(7-8-20-12)22-13(19)9-18-17/h7-9,11-12,14H,10H2,1-6H3/t11-,12-,14+/m1/s1 |
| InChIKey | VDLSVUAVJJUAJV-BZPMIXESSA-N |
| XLogP | 2.57 |
| TPSA | 90.39 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.48 |
| LogP ≤ 5 | 2.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|