About ethyl (E)-3-hydroxy-2-[(E)-3,3,3-trifluoro-1-phenylsulfanylprop-1-en-2-yl]pent-2-enoate
ethyl (E)-3-hydroxy-2-[(E)-3,3,3-trifluoro-1-phenylsulfanylprop-1-en-2-yl]pent-2-enoate (PubChem CID 102378509) has the molecular formula C16H17F3O3S
and a molecular weight of 346.37 g/mol. Its IUPAC name is ethyl (E)-3-hydroxy-2-[(E)-3,3,3-trifluoro-1-phenylsulfanylprop-1-en-2-yl]pent-2-enoate.
Molecular Properties
| Compound Name | ethyl (E)-3-hydroxy-2-[(E)-3,3,3-trifluoro-1-phenylsulfanylprop-1-en-2-yl]pent-2-enoate |
| PubChem CID | 102378509 |
| Molecular Formula | C16H17F3O3S |
| Molecular Weight | 346.37 g/mol |
| Exact Mass | 346.09 |
| IUPAC Name | ethyl (E)-3-hydroxy-2-[(E)-3,3,3-trifluoro-1-phenylsulfanylprop-1-en-2-yl]pent-2-enoate |
| SMILES | CCOC(=O)C(/C(=C\Sc1ccccc1)C(F)(F)F)=C(/O)CC |
| InChI | InChI=1S/C16H17F3O3S/c1-3-13(20)14(15(21)22-4-2)12(16(17,18)19)10-23-11-8-6-5-7-9-11/h5-10,20H,3-4H2,1-2H3/b12-10+,14-13+ |
| InChIKey | CVQMJAPVZOVGSA-HBKPYOMSSA-N |
| XLogP | 5.01 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 346.37 |
| LogP ≤ 5 | 5.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|
Analyze ethyl (E)-3-hydroxy-2-[(E)-3,3,3-trifluoro-1-phenylsulfanylprop-1-en-2-yl]pent-2-enoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethyl (E)-3-hydroxy-2-[(E)-3,3,3-trifluoro-1-phenylsulfanylprop-1-en-2-yl]pent-2-enoate?
The IUPAC name of ethyl (E)-3-hydroxy-2-[(E)-3,3,3-trifluoro-1-phenylsulfanylprop-1-en-2-yl]pent-2-enoate (CID 102378509) is ethyl (E)-3-hydroxy-2-[(E)-3,3,3-trifluoro-1-phenylsulfanylprop-1-en-2-yl]pent-2-enoate.
What is the SMILES notation for ethyl (E)-3-hydroxy-2-[(E)-3,3,3-trifluoro-1-phenylsulfanylprop-1-en-2-yl]pent-2-enoate?
The canonical SMILES for ethyl (E)-3-hydroxy-2-[(E)-3,3,3-trifluoro-1-phenylsulfanylprop-1-en-2-yl]pent-2-enoate is CCOC(=O)C(/C(=C\Sc1ccccc1)C(F)(F)F)=C(/O)CC.
What is the InChIKey of ethyl (E)-3-hydroxy-2-[(E)-3,3,3-trifluoro-1-phenylsulfanylprop-1-en-2-yl]pent-2-enoate?
The InChIKey is CVQMJAPVZOVGSA-HBKPYOMSSA-N. The full InChI is InChI=1S/C16H17F3O3S/c1-3-13(20)14(15(21)22-4-2)12(16(17,18)19)10-23-11-8-6-5-7-9-11/h5-10,20H,3-4H2,1-2H3/b12-10+,14-13+.
What are the key properties of ethyl (E)-3-hydroxy-2-[(E)-3,3,3-trifluoro-1-phenylsulfanylprop-1-en-2-yl]pent-2-enoate?
ethyl (E)-3-hydroxy-2-[(E)-3,3,3-trifluoro-1-phenylsulfanylprop-1-en-2-yl]pent-2-enoate has a molecular weight of 346.37 g/mol, XLogP of 5.01, 6 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for ethyl (E)-3-hydroxy-2-[(E)-3,3,3-trifluoro-1-phenylsulfanylprop-1-en-2-yl]pent-2-enoate is sourced from PubChem (CID 102378509), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).