C40H82O7Si5 — CID 102379149
(6Z)-4-[2-[tert-butyl(dimethyl)silyl]oxy-4-trimethylsilylbut-3-ynyl]-6-[2,4,5-tris[[tert-butyl(dimethyl)silyl]oxy]pentylidene]-1,3-dioxan-2-one (PubChem CID 102379149) has the molecular formula C40H82O7Si5 and a molecular weight of 815.52 g/mol. Its IUPAC name is (6Z)-4-[2-[tert-butyl(dimethyl)silyl]oxy-4-trimethylsilylbut-3-ynyl]-6-[2,4,5-tris[[tert-butyl(dimethyl)silyl]oxy]pentylidene]-1,3-dioxan-2-one.
| Compound Name | (6Z)-4-[2-[tert-butyl(dimethyl)silyl]oxy-4-trimethylsilylbut-3-ynyl]-6-[2,4,5-tris[[tert-butyl(dimethyl)silyl]oxy]pentylidene]-1,3-dioxan-2-one |
|---|---|
| PubChem CID | 102379149 |
| Molecular Formula | C40H82O7Si5 |
| Molecular Weight | 815.52 g/mol |
| Exact Mass | 814.49 |
| IUPAC Name | (6Z)-4-[2-[tert-butyl(dimethyl)silyl]oxy-4-trimethylsilylbut-3-ynyl]-6-[2,4,5-tris[[tert-butyl(dimethyl)silyl]oxy]pentylidene]-1,3-dioxan-2-one |
| SMILES | CC(C)(C)[Si](C)(C)OCC(CC(/C=C1/CC(CC(C#C[Si](C)(C)C)O[Si](C)(C)C(C)(C)C)OC(=O)O1)O[Si](C)(C)C(C)(C)C)O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C40H82O7Si5/c1-37(2,3)49(16,17)42-30-35(47-52(22,23)40(10,11)12)29-34(46-51(20,21)39(7,8)9)28-33-27-32(43-36(41)44-33)26-31(24-25-48(13,14)15)45-50(18,19)38(4,5)6/h28,31-32,34-35H,26-27,29-30H2,1-23H3/b33-28- |
| InChIKey | GUOVVWCAFHMVSH-MDVFONAFSA-N |
| XLogP | 12.65 |
| TPSA | 72.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 52 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 815.52 |
| LogP ≤ 5 | 12.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|