C28H41NO5Si — CID 102380187
13-O-tert-butyl 10-O-ethyl (1S,8R,9S,12R)-11-[2-[tert-butyl(dimethyl)silyl]oxyethyl]-13-azatetracyclo[6.4.1.02,7.09,12]trideca-2,4,6,10-tetraene-10,13-dicarboxylate (PubChem CID 102380187) has the molecular formula C28H41NO5Si and a molecular weight of 499.72 g/mol. Its IUPAC name is 13-O-tert-butyl 10-O-ethyl (1S,8R,9S,12R)-11-[2-[tert-butyl(dimethyl)silyl]oxyethyl]-13-azatetracyclo[6.4.1.02,7.09,12]trideca-2,4,6,10-tetraene-10,13-dicarboxylate.
| Compound Name | 13-O-tert-butyl 10-O-ethyl (1S,8R,9S,12R)-11-[2-[tert-butyl(dimethyl)silyl]oxyethyl]-13-azatetracyclo[6.4.1.02,7.09,12]trideca-2,4,6,10-tetraene-10,13-dicarboxylate |
|---|---|
| PubChem CID | 102380187 |
| Molecular Formula | C28H41NO5Si |
| Molecular Weight | 499.72 g/mol |
| Exact Mass | 499.28 |
| IUPAC Name | 13-O-tert-butyl 10-O-ethyl (1S,8R,9S,12R)-11-[2-[tert-butyl(dimethyl)silyl]oxyethyl]-13-azatetracyclo[6.4.1.02,7.09,12]trideca-2,4,6,10-tetraene-10,13-dicarboxylate |
| SMILES | CCOC(=O)C1=C(CCO[Si](C)(C)C(C)(C)C)[C@H]2[C@@H]1[C@@H]1c3ccccc3[C@H]2N1C(=O)OC(C)(C)C |
| InChI | InChI=1S/C28H41NO5Si/c1-10-32-25(30)21-19(15-16-33-35(8,9)28(5,6)7)20-22(21)24-18-14-12-11-13-17(18)23(20)29(24)26(31)34-27(2,3)4/h11-14,20,22-24H,10,15-16H2,1-9H3/t20-,22-,23+,24-/m0/s1 |
| InChIKey | CMAZMLNVOSXMPL-XGAJZPNHSA-N |
| XLogP | 6.55 |
| TPSA | 65.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 499.72 |
| LogP ≤ 5 | 6.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|