C18H9F17O — CID 102380324
1-ethenyl-4-[1,1,1,4,5,5,5-heptafluoro-3-(1,1,1,2,3,3,3-heptafluoropropan-2-yl)-4-(trifluoromethyl)pent-2-en-2-yl]oxy-2-methylbenzene (PubChem CID 102380324) has the molecular formula C18H9F17O and a molecular weight of 564.24 g/mol. Its IUPAC name is 1-ethenyl-4-[1,1,1,4,5,5,5-heptafluoro-3-(1,1,1,2,3,3,3-heptafluoropropan-2-yl)-4-(trifluoromethyl)pent-2-en-2-yl]oxy-2-methylbenzene.
| Compound Name | 1-ethenyl-4-[1,1,1,4,5,5,5-heptafluoro-3-(1,1,1,2,3,3,3-heptafluoropropan-2-yl)-4-(trifluoromethyl)pent-2-en-2-yl]oxy-2-methylbenzene |
|---|---|
| PubChem CID | 102380324 |
| Molecular Formula | C18H9F17O |
| Molecular Weight | 564.24 g/mol |
| Exact Mass | 564.04 |
| IUPAC Name | 1-ethenyl-4-[1,1,1,4,5,5,5-heptafluoro-3-(1,1,1,2,3,3,3-heptafluoropropan-2-yl)-4-(trifluoromethyl)pent-2-en-2-yl]oxy-2-methylbenzene |
| SMILES | C=Cc1ccc(OC(=C(C(F)(C(F)(F)F)C(F)(F)F)C(F)(C(F)(F)F)C(F)(F)F)C(F)(F)F)cc1C |
| InChI | InChI=1S/C18H9F17O/c1-3-8-4-5-9(6-7(8)2)36-11(14(21,22)23)10(12(19,15(24,25)26)16(27,28)29)13(20,17(30,31)32)18(33,34)35/h3-6H,1H2,2H3 |
| InChIKey | HUIILGNEBWHRPH-UHFFFAOYSA-N |
| XLogP | 8.50 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 564.24 |
| LogP ≤ 5 | 8.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'} |
|---|