C21H26FNO7 — CID 10238039
(4S,5R,6E,9S,10S,12E)-7-fluoro-9,10,18-trihydroxy-16-(2-hydroxyethylamino)-4,5-dimethyl-3-oxabicyclo[12.4.0]octadeca-1(14),6,12,15,17-pentaene-2,8-dione (PubChem CID 10238039) has the molecular formula C21H26FNO7 and a molecular weight of 423.44 g/mol. Its IUPAC name is (4S,5R,6E,9S,10S,12E)-7-fluoro-9,10,18-trihydroxy-16-(2-hydroxyethylamino)-4,5-dimethyl-3-oxabicyclo[12.4.0]octadeca-1(14),6,12,15,17-pentaene-2,8-dione.
| Compound Name | (4S,5R,6E,9S,10S,12E)-7-fluoro-9,10,18-trihydroxy-16-(2-hydroxyethylamino)-4,5-dimethyl-3-oxabicyclo[12.4.0]octadeca-1(14),6,12,15,17-pentaene-2,8-dione |
|---|---|
| PubChem CID | 10238039 |
| Molecular Formula | C21H26FNO7 |
| Molecular Weight | 423.44 g/mol |
| Exact Mass | 423.17 |
| IUPAC Name | (4S,5R,6E,9S,10S,12E)-7-fluoro-9,10,18-trihydroxy-16-(2-hydroxyethylamino)-4,5-dimethyl-3-oxabicyclo[12.4.0]octadeca-1(14),6,12,15,17-pentaene-2,8-dione |
| SMILES | C[C@@H]1/C=C(/F)C(=O)[C@@H](O)[C@@H](O)C/C=C/c2cc(NCCO)cc(O)c2C(=O)O[C@H]1C |
| InChI | InChI=1S/C21H26FNO7/c1-11-8-15(22)19(27)20(28)16(25)5-3-4-13-9-14(23-6-7-24)10-17(26)18(13)21(29)30-12(11)2/h3-4,8-12,16,20,23-26,28H,5-7H2,1-2H3/b4-3+,15-8+/t11-,12+,16+,20+/m1/s1 |
| InChIKey | SHSNZFWKECCFOP-HSKXVXMZSA-N |
| XLogP | 1.54 |
| TPSA | 136.32 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 423.44 |
| LogP ≤ 5 | 1.54 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'ene_one_hal(17)', 'substructure': 'N/A'} |
|---|