C27H31NO8 — CID 102380546
(3R,5R,6S,7aR)-3-(1,3-benzodioxol-5-yl)-5,6-bis(methoxymethoxy)-1-[(4-methoxyphenyl)methyl]-5,6,7,7a-tetrahydro-3H-indol-2-one (PubChem CID 102380546) has the molecular formula C27H31NO8 and a molecular weight of 497.54 g/mol. Its IUPAC name is (3R,5R,6S,7aR)-3-(1,3-benzodioxol-5-yl)-5,6-bis(methoxymethoxy)-1-[(4-methoxyphenyl)methyl]-5,6,7,7a-tetrahydro-3H-indol-2-one.
| Compound Name | (3R,5R,6S,7aR)-3-(1,3-benzodioxol-5-yl)-5,6-bis(methoxymethoxy)-1-[(4-methoxyphenyl)methyl]-5,6,7,7a-tetrahydro-3H-indol-2-one |
|---|---|
| PubChem CID | 102380546 |
| Molecular Formula | C27H31NO8 |
| Molecular Weight | 497.54 g/mol |
| Exact Mass | 497.20 |
| IUPAC Name | (3R,5R,6S,7aR)-3-(1,3-benzodioxol-5-yl)-5,6-bis(methoxymethoxy)-1-[(4-methoxyphenyl)methyl]-5,6,7,7a-tetrahydro-3H-indol-2-one |
| SMILES | COCO[C@H]1C[C@@H]2C(=C[C@H]1OCOC)[C@@H](c1ccc3c(c1)OCO3)C(=O)N2Cc1ccc(OC)cc1 |
| InChI | InChI=1S/C27H31NO8/c1-30-14-33-24-11-20-21(12-25(24)34-15-31-2)28(13-17-4-7-19(32-3)8-5-17)27(29)26(20)18-6-9-22-23(10-18)36-16-35-22/h4-11,21,24-26H,12-16H2,1-3H3/t21-,24-,25+,26-/m1/s1 |
| InChIKey | BFFRAPMFOBAYPH-ATPOPXNDSA-N |
| XLogP | 3.23 |
| TPSA | 84.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 497.54 |
| LogP ≤ 5 | 3.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|