C23H25NO5 — CID 102380548
(3R,5R,6S,7aR)-3-(1,3-benzodioxol-5-yl)-1-[(4-methoxyphenyl)methyl]-2,3,5,6,7,7a-hexahydroindole-5,6-diol (PubChem CID 102380548) has the molecular formula C23H25NO5 and a molecular weight of 395.46 g/mol. Its IUPAC name is (3R,5R,6S,7aR)-3-(1,3-benzodioxol-5-yl)-1-[(4-methoxyphenyl)methyl]-2,3,5,6,7,7a-hexahydroindole-5,6-diol.
| Compound Name | (3R,5R,6S,7aR)-3-(1,3-benzodioxol-5-yl)-1-[(4-methoxyphenyl)methyl]-2,3,5,6,7,7a-hexahydroindole-5,6-diol |
|---|---|
| PubChem CID | 102380548 |
| Molecular Formula | C23H25NO5 |
| Molecular Weight | 395.46 g/mol |
| Exact Mass | 395.17 |
| IUPAC Name | (3R,5R,6S,7aR)-3-(1,3-benzodioxol-5-yl)-1-[(4-methoxyphenyl)methyl]-2,3,5,6,7,7a-hexahydroindole-5,6-diol |
| SMILES | COc1ccc(CN2C[C@H](c3ccc4c(c3)OCO4)C3=C[C@@H](O)[C@@H](O)C[C@H]32)cc1 |
| InChI | InChI=1S/C23H25NO5/c1-27-16-5-2-14(3-6-16)11-24-12-18(17-9-20(25)21(26)10-19(17)24)15-4-7-22-23(8-15)29-13-28-22/h2-9,18-21,25-26H,10-13H2,1H3/t18-,19-,20-,21+/m1/s1 |
| InChIKey | HNXCUIDIQQXFLX-NCYKPQTJSA-N |
| XLogP | 2.44 |
| TPSA | 71.39 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.46 |
| LogP ≤ 5 | 2.44 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|