About [(Z)-3-[(2S,3S)-2-methoxyoxan-3-yl]oxyprop-1-enyl]-trimethylsilane
[(Z)-3-[(2S,3S)-2-methoxyoxan-3-yl]oxyprop-1-enyl]-trimethylsilane (PubChem CID 102380574) has the molecular formula C12H24O3Si
and a molecular weight of 244.41 g/mol. Its IUPAC name is [(Z)-3-[(2S,3S)-2-methoxyoxan-3-yl]oxyprop-1-enyl]-trimethylsilane.
Molecular Properties
| Compound Name | [(Z)-3-[(2S,3S)-2-methoxyoxan-3-yl]oxyprop-1-enyl]-trimethylsilane |
| PubChem CID | 102380574 |
| Molecular Formula | C12H24O3Si |
| Molecular Weight | 244.41 g/mol |
| Exact Mass | 244.15 |
| IUPAC Name | [(Z)-3-[(2S,3S)-2-methoxyoxan-3-yl]oxyprop-1-enyl]-trimethylsilane |
| SMILES | CO[C@H]1OCCC[C@@H]1OC/C=C\[Si](C)(C)C |
| InChI | InChI=1S/C12H24O3Si/c1-13-12-11(7-5-8-15-12)14-9-6-10-16(2,3)4/h6,10-12H,5,7-9H2,1-4H3/b10-6-/t11-,12-/m0/s1 |
| InChIKey | WEVZHIFFQRDBQB-AUSWNFFYSA-N |
| XLogP | 2.59 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 244.41 |
| LogP ≤ 5 | 2.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze [(Z)-3-[(2S,3S)-2-methoxyoxan-3-yl]oxyprop-1-enyl]-trimethylsilane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [(Z)-3-[(2S,3S)-2-methoxyoxan-3-yl]oxyprop-1-enyl]-trimethylsilane?
The IUPAC name of [(Z)-3-[(2S,3S)-2-methoxyoxan-3-yl]oxyprop-1-enyl]-trimethylsilane (CID 102380574) is [(Z)-3-[(2S,3S)-2-methoxyoxan-3-yl]oxyprop-1-enyl]-trimethylsilane.
What is the SMILES notation for [(Z)-3-[(2S,3S)-2-methoxyoxan-3-yl]oxyprop-1-enyl]-trimethylsilane?
The canonical SMILES for [(Z)-3-[(2S,3S)-2-methoxyoxan-3-yl]oxyprop-1-enyl]-trimethylsilane is CO[C@H]1OCCC[C@@H]1OC/C=C\[Si](C)(C)C.
What is the InChIKey of [(Z)-3-[(2S,3S)-2-methoxyoxan-3-yl]oxyprop-1-enyl]-trimethylsilane?
The InChIKey is WEVZHIFFQRDBQB-AUSWNFFYSA-N. The full InChI is InChI=1S/C12H24O3Si/c1-13-12-11(7-5-8-15-12)14-9-6-10-16(2,3)4/h6,10-12H,5,7-9H2,1-4H3/b10-6-/t11-,12-/m0/s1.
What are the key properties of [(Z)-3-[(2S,3S)-2-methoxyoxan-3-yl]oxyprop-1-enyl]-trimethylsilane?
[(Z)-3-[(2S,3S)-2-methoxyoxan-3-yl]oxyprop-1-enyl]-trimethylsilane has a molecular weight of 244.41 g/mol, XLogP of 2.59, 5 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for [(Z)-3-[(2S,3S)-2-methoxyoxan-3-yl]oxyprop-1-enyl]-trimethylsilane is sourced from PubChem (CID 102380574), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).