C32H66O6Si2 — CID 102380832
(E,3S,6R,7S,8R,9S,10S)-6-[tert-butyl(dimethyl)silyl]oxy-10-[(4S)-2,2-dimethyl-1,3-dioxolan-4-yl]-10-methoxy-3,5,7,9-tetramethyl-8-triethylsilyloxydec-4-en-2-ol (PubChem CID 102380832) has the molecular formula C32H66O6Si2 and a molecular weight of 603.05 g/mol. Its IUPAC name is (E,3S,6R,7S,8R,9S,10S)-6-[tert-butyl(dimethyl)silyl]oxy-10-[(4S)-2,2-dimethyl-1,3-dioxolan-4-yl]-10-methoxy-3,5,7,9-tetramethyl-8-triethylsilyloxydec-4-en-2-ol.
| Compound Name | (E,3S,6R,7S,8R,9S,10S)-6-[tert-butyl(dimethyl)silyl]oxy-10-[(4S)-2,2-dimethyl-1,3-dioxolan-4-yl]-10-methoxy-3,5,7,9-tetramethyl-8-triethylsilyloxydec-4-en-2-ol |
|---|---|
| PubChem CID | 102380832 |
| Molecular Formula | C32H66O6Si2 |
| Molecular Weight | 603.05 g/mol |
| Exact Mass | 602.44 |
| IUPAC Name | (E,3S,6R,7S,8R,9S,10S)-6-[tert-butyl(dimethyl)silyl]oxy-10-[(4S)-2,2-dimethyl-1,3-dioxolan-4-yl]-10-methoxy-3,5,7,9-tetramethyl-8-triethylsilyloxydec-4-en-2-ol |
| SMILES | CC[Si](CC)(CC)O[C@H]([C@@H](C)[C@H](OC)[C@@H]1COC(C)(C)O1)[C@H](C)[C@@H](O[Si](C)(C)C(C)(C)C)/C(C)=C/[C@H](C)C(C)O |
| InChI | InChI=1S/C32H66O6Si2/c1-17-40(18-2,19-3)38-29(25(7)30(34-14)27-21-35-32(12,13)36-27)24(6)28(23(5)20-22(4)26(8)33)37-39(15,16)31(9,10)11/h20,22,24-30,33H,17-19,21H2,1-16H3/b23-20+/t22-,24+,25+,26?,27-,28-,29-,30-/m0/s1 |
| InChIKey | RCNFBYMYGUZMKY-RSRCAXBVSA-N |
| XLogP | 8.17 |
| TPSA | 66.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 603.05 |
| LogP ≤ 5 | 8.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|