About 2-(prop-2-ynoxymethyl)bicyclo[2.2.1]hepta-2,5-diene
2-(prop-2-ynoxymethyl)bicyclo[2.2.1]hepta-2,5-diene (PubChem CID 102380969) has the molecular formula C11H12O
and a molecular weight of 160.22 g/mol. Its IUPAC name is 2-(prop-2-ynoxymethyl)bicyclo[2.2.1]hepta-2,5-diene.
Molecular Properties
| Compound Name | 2-(prop-2-ynoxymethyl)bicyclo[2.2.1]hepta-2,5-diene |
| PubChem CID | 102380969 |
| Molecular Formula | C11H12O |
| Molecular Weight | 160.22 g/mol |
| Exact Mass | 160.09 |
| IUPAC Name | 2-(prop-2-ynoxymethyl)bicyclo[2.2.1]hepta-2,5-diene |
| SMILES | C#CCOCC1=CC2C=CC1C2 |
| InChI | InChI=1S/C11H12O/c1-2-5-12-8-11-7-9-3-4-10(11)6-9/h1,3-4,7,9-10H,5-6,8H2 |
| InChIKey | LWEJMODKDCCOHZ-UHFFFAOYSA-N |
| XLogP | 1.77 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 160.22 |
| LogP ≤ 5 | 1.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|
Analyze 2-(prop-2-ynoxymethyl)bicyclo[2.2.1]hepta-2,5-diene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(prop-2-ynoxymethyl)bicyclo[2.2.1]hepta-2,5-diene?
The IUPAC name of 2-(prop-2-ynoxymethyl)bicyclo[2.2.1]hepta-2,5-diene (CID 102380969) is 2-(prop-2-ynoxymethyl)bicyclo[2.2.1]hepta-2,5-diene.
What is the SMILES notation for 2-(prop-2-ynoxymethyl)bicyclo[2.2.1]hepta-2,5-diene?
The canonical SMILES for 2-(prop-2-ynoxymethyl)bicyclo[2.2.1]hepta-2,5-diene is C#CCOCC1=CC2C=CC1C2.
What is the InChIKey of 2-(prop-2-ynoxymethyl)bicyclo[2.2.1]hepta-2,5-diene?
The InChIKey is LWEJMODKDCCOHZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H12O/c1-2-5-12-8-11-7-9-3-4-10(11)6-9/h1,3-4,7,9-10H,5-6,8H2.
What are the key properties of 2-(prop-2-ynoxymethyl)bicyclo[2.2.1]hepta-2,5-diene?
2-(prop-2-ynoxymethyl)bicyclo[2.2.1]hepta-2,5-diene has a molecular weight of 160.22 g/mol, XLogP of 1.77, 3 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(prop-2-ynoxymethyl)bicyclo[2.2.1]hepta-2,5-diene is sourced from PubChem (CID 102380969), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).