C18H17ClN2O — CID 102381329
[(1S,2R,3R,4R)-3-(4-chlorophenyl)-2-bicyclo[2.2.1]hept-5-enyl]-(1-methylimidazol-2-yl)methanone (PubChem CID 102381329) has the molecular formula C18H17ClN2O and a molecular weight of 312.80 g/mol. Its IUPAC name is [(1S,2R,3R,4R)-3-(4-chlorophenyl)-2-bicyclo[2.2.1]hept-5-enyl]-(1-methylimidazol-2-yl)methanone.
| Compound Name | [(1S,2R,3R,4R)-3-(4-chlorophenyl)-2-bicyclo[2.2.1]hept-5-enyl]-(1-methylimidazol-2-yl)methanone |
|---|---|
| PubChem CID | 102381329 |
| Molecular Formula | C18H17ClN2O |
| Molecular Weight | 312.80 g/mol |
| Exact Mass | 312.10 |
| IUPAC Name | [(1S,2R,3R,4R)-3-(4-chlorophenyl)-2-bicyclo[2.2.1]hept-5-enyl]-(1-methylimidazol-2-yl)methanone |
| SMILES | Cn1ccnc1C(=O)[C@H]1[C@H](c2ccc(Cl)cc2)[C@H]2C=C[C@@H]1C2 |
| InChI | InChI=1S/C18H17ClN2O/c1-21-9-8-20-18(21)17(22)16-13-3-2-12(10-13)15(16)11-4-6-14(19)7-5-11/h2-9,12-13,15-16H,10H2,1H3/t12-,13+,15+,16+/m0/s1 |
| InChIKey | WIGLZVUBZLMSAG-SJXGUFTOSA-N |
| XLogP | 3.86 |
| TPSA | 34.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.80 |
| LogP ≤ 5 | 3.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|