C18H21NO6S — CID 102381406
dimethyl (3aS,6R,6aR)-2-(4-methylphenyl)sulfonyl-3,3a,6,6a-tetrahydro-1H-cyclopenta[c]pyrrole-4,6-dicarboxylate (PubChem CID 102381406) has the molecular formula C18H21NO6S and a molecular weight of 379.43 g/mol. Its IUPAC name is dimethyl (3aS,6R,6aR)-2-(4-methylphenyl)sulfonyl-3,3a,6,6a-tetrahydro-1H-cyclopenta[c]pyrrole-4,6-dicarboxylate.
| Compound Name | dimethyl (3aS,6R,6aR)-2-(4-methylphenyl)sulfonyl-3,3a,6,6a-tetrahydro-1H-cyclopenta[c]pyrrole-4,6-dicarboxylate |
|---|---|
| PubChem CID | 102381406 |
| Molecular Formula | C18H21NO6S |
| Molecular Weight | 379.43 g/mol |
| Exact Mass | 379.11 |
| IUPAC Name | dimethyl (3aS,6R,6aR)-2-(4-methylphenyl)sulfonyl-3,3a,6,6a-tetrahydro-1H-cyclopenta[c]pyrrole-4,6-dicarboxylate |
| SMILES | COC(=O)C1=C[C@@H](C(=O)OC)[C@@H]2CN(S(=O)(=O)c3ccc(C)cc3)C[C@H]12 |
| InChI | InChI=1S/C18H21NO6S/c1-11-4-6-12(7-5-11)26(22,23)19-9-15-13(17(20)24-2)8-14(16(15)10-19)18(21)25-3/h4-8,13,15-16H,9-10H2,1-3H3/t13-,15+,16-/m1/s1 |
| InChIKey | RPPTUODIXCPXHM-VNQPRFMTSA-N |
| XLogP | 1.13 |
| TPSA | 89.98 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.43 |
| LogP ≤ 5 | 1.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |