About 5-[2-[4-[(2,5-dichlorophenyl)methyl]piperazin-1-yl]ethoxy]-2-methylquinoline
5-[2-[4-[(2,5-dichlorophenyl)methyl]piperazin-1-yl]ethoxy]-2-methylquinoline (PubChem CID 10238160) has the molecular formula C23H25Cl2N3O
and a molecular weight of 430.38 g/mol. Its IUPAC name is 5-[2-[4-[(2,5-dichlorophenyl)methyl]piperazin-1-yl]ethoxy]-2-methylquinoline.
Molecular Properties
| Compound Name | 5-[2-[4-[(2,5-dichlorophenyl)methyl]piperazin-1-yl]ethoxy]-2-methylquinoline |
| PubChem CID | 10238160 |
| Molecular Formula | C23H25Cl2N3O |
| Molecular Weight | 430.38 g/mol |
| Exact Mass | 429.14 |
| IUPAC Name | 5-[2-[4-[(2,5-dichlorophenyl)methyl]piperazin-1-yl]ethoxy]-2-methylquinoline |
| SMILES | Cc1ccc2c(OCCN3CCN(Cc4cc(Cl)ccc4Cl)CC3)cccc2n1 |
| InChI | InChI=1S/C23H25Cl2N3O/c1-17-5-7-20-22(26-17)3-2-4-23(20)29-14-13-27-9-11-28(12-10-27)16-18-15-19(24)6-8-21(18)25/h2-8,15H,9-14,16H2,1H3 |
| InChIKey | NEKNPPRWLZIEGE-UHFFFAOYSA-N |
| XLogP | 5.05 |
| TPSA | 28.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 430.38 |
| LogP ≤ 5 | 5.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 5-[2-[4-[(2,5-dichlorophenyl)methyl]piperazin-1-yl]ethoxy]-2-methylquinoline with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-[2-[4-[(2,5-dichlorophenyl)methyl]piperazin-1-yl]ethoxy]-2-methylquinoline?
The IUPAC name of 5-[2-[4-[(2,5-dichlorophenyl)methyl]piperazin-1-yl]ethoxy]-2-methylquinoline (CID 10238160) is 5-[2-[4-[(2,5-dichlorophenyl)methyl]piperazin-1-yl]ethoxy]-2-methylquinoline.
What is the SMILES notation for 5-[2-[4-[(2,5-dichlorophenyl)methyl]piperazin-1-yl]ethoxy]-2-methylquinoline?
The canonical SMILES for 5-[2-[4-[(2,5-dichlorophenyl)methyl]piperazin-1-yl]ethoxy]-2-methylquinoline is Cc1ccc2c(OCCN3CCN(Cc4cc(Cl)ccc4Cl)CC3)cccc2n1.
What is the InChIKey of 5-[2-[4-[(2,5-dichlorophenyl)methyl]piperazin-1-yl]ethoxy]-2-methylquinoline?
The InChIKey is NEKNPPRWLZIEGE-UHFFFAOYSA-N. The full InChI is InChI=1S/C23H25Cl2N3O/c1-17-5-7-20-22(26-17)3-2-4-23(20)29-14-13-27-9-11-28(12-10-27)16-18-15-19(24)6-8-21(18)25/h2-8,15H,9-14,16H2,1H3.
What are the key properties of 5-[2-[4-[(2,5-dichlorophenyl)methyl]piperazin-1-yl]ethoxy]-2-methylquinoline?
5-[2-[4-[(2,5-dichlorophenyl)methyl]piperazin-1-yl]ethoxy]-2-methylquinoline has a molecular weight of 430.38 g/mol, XLogP of 5.05, 6 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 5-[2-[4-[(2,5-dichlorophenyl)methyl]piperazin-1-yl]ethoxy]-2-methylquinoline is sourced from PubChem (CID 10238160), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).