C23H29NO7 — CID 10238173
(4S,5R,6Z,9S,10S,12E)-9,10,18-trihydroxy-4,5-dimethyl-16-morpholin-4-yl-3-oxabicyclo[12.4.0]octadeca-1(14),6,12,15,17-pentaene-2,8-dione (PubChem CID 10238173) has the molecular formula C23H29NO7 and a molecular weight of 431.49 g/mol. Its IUPAC name is (4S,5R,6Z,9S,10S,12E)-9,10,18-trihydroxy-4,5-dimethyl-16-morpholin-4-yl-3-oxabicyclo[12.4.0]octadeca-1(14),6,12,15,17-pentaene-2,8-dione.
| Compound Name | (4S,5R,6Z,9S,10S,12E)-9,10,18-trihydroxy-4,5-dimethyl-16-morpholin-4-yl-3-oxabicyclo[12.4.0]octadeca-1(14),6,12,15,17-pentaene-2,8-dione |
|---|---|
| PubChem CID | 10238173 |
| Molecular Formula | C23H29NO7 |
| Molecular Weight | 431.49 g/mol |
| Exact Mass | 431.19 |
| IUPAC Name | (4S,5R,6Z,9S,10S,12E)-9,10,18-trihydroxy-4,5-dimethyl-16-morpholin-4-yl-3-oxabicyclo[12.4.0]octadeca-1(14),6,12,15,17-pentaene-2,8-dione |
| SMILES | C[C@@H]1/C=C\C(=O)[C@@H](O)[C@@H](O)C/C=C/c2cc(N3CCOCC3)cc(O)c2C(=O)O[C@H]1C |
| InChI | InChI=1S/C23H29NO7/c1-14-6-7-19(26)22(28)18(25)5-3-4-16-12-17(24-8-10-30-11-9-24)13-20(27)21(16)23(29)31-15(14)2/h3-4,6-7,12-15,18,22,25,27-28H,5,8-11H2,1-2H3/b4-3+,7-6-/t14-,15+,18+,22+/m1/s1 |
| InChIKey | SIOWWLWUULGGSP-QLELARBRSA-N |
| XLogP | 1.67 |
| TPSA | 116.53 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 431.49 |
| LogP ≤ 5 | 1.67 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |