C21H35NO5Si — CID 102381971
8-O-tert-butyl 2-O-methyl (1R,5R)-3-[tert-butyl(dimethyl)silyl]oxy-5-methyl-8-azabicyclo[3.2.1]octa-2,6-diene-2,8-dicarboxylate (PubChem CID 102381971) has the molecular formula C21H35NO5Si and a molecular weight of 409.60 g/mol. Its IUPAC name is 8-O-tert-butyl 2-O-methyl (1R,5R)-3-[tert-butyl(dimethyl)silyl]oxy-5-methyl-8-azabicyclo[3.2.1]octa-2,6-diene-2,8-dicarboxylate.
| Compound Name | 8-O-tert-butyl 2-O-methyl (1R,5R)-3-[tert-butyl(dimethyl)silyl]oxy-5-methyl-8-azabicyclo[3.2.1]octa-2,6-diene-2,8-dicarboxylate |
|---|---|
| PubChem CID | 102381971 |
| Molecular Formula | C21H35NO5Si |
| Molecular Weight | 409.60 g/mol |
| Exact Mass | 409.23 |
| IUPAC Name | 8-O-tert-butyl 2-O-methyl (1R,5R)-3-[tert-butyl(dimethyl)silyl]oxy-5-methyl-8-azabicyclo[3.2.1]octa-2,6-diene-2,8-dicarboxylate |
| SMILES | COC(=O)C1=C(O[Si](C)(C)C(C)(C)C)C[C@]2(C)C=C[C@H]1N2C(=O)OC(C)(C)C |
| InChI | InChI=1S/C21H35NO5Si/c1-19(2,3)26-18(24)22-14-11-12-21(22,7)13-15(16(14)17(23)25-8)27-28(9,10)20(4,5)6/h11-12,14H,13H2,1-10H3/t14-,21+/m1/s1 |
| InChIKey | KFKZDPZLBJQKFG-SZNDQCEHSA-N |
| XLogP | 4.77 |
| TPSA | 65.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.60 |
| LogP ≤ 5 | 4.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|