C10H12O3 — CID 102381990
(1R,4S,7R,9R)-2,11-dioxatetracyclo[5.4.1.04,12.09,12]dodecan-6-one (PubChem CID 102381990) has the molecular formula C10H12O3 and a molecular weight of 180.20 g/mol. Its IUPAC name is (1R,4S,7R,9R)-2,11-dioxatetracyclo[5.4.1.04,12.09,12]dodecan-6-one.
| Compound Name | (1R,4S,7R,9R)-2,11-dioxatetracyclo[5.4.1.04,12.09,12]dodecan-6-one |
|---|---|
| PubChem CID | 102381990 |
| Molecular Formula | C10H12O3 |
| Molecular Weight | 180.20 g/mol |
| Exact Mass | 180.08 |
| IUPAC Name | (1R,4S,7R,9R)-2,11-dioxatetracyclo[5.4.1.04,12.09,12]dodecan-6-one |
| SMILES | O=C1C[C@@H]2CO[C@H]3OCC4C[C@@H]1C423 |
| InChI | InChI=1S/C10H12O3/c11-8-2-6-4-13-9-10(6)5(3-12-9)1-7(8)10/h5-7,9H,1-4H2/t5?,6-,7+,9-,10?/m1/s1 |
| InChIKey | HWSWAFYCOOAUAV-SPVMFIPESA-N |
| XLogP | 0.58 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 180.20 |
| LogP ≤ 5 | 0.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |