C10H10BrF3O — CID 102382269
(2R)-2-(4-bromophenyl)-1,1,1-trifluorobutan-2-ol (PubChem CID 102382269) has the molecular formula C10H10BrF3O and a molecular weight of 283.09 g/mol. Its IUPAC name is (2R)-2-(4-bromophenyl)-1,1,1-trifluorobutan-2-ol.
| Compound Name | (2R)-2-(4-bromophenyl)-1,1,1-trifluorobutan-2-ol |
|---|---|
| PubChem CID | 102382269 |
| Molecular Formula | C10H10BrF3O |
| Molecular Weight | 283.09 g/mol |
| Exact Mass | 281.99 |
| IUPAC Name | (2R)-2-(4-bromophenyl)-1,1,1-trifluorobutan-2-ol |
| SMILES | CC[C@@](O)(c1ccc(Br)cc1)C(F)(F)F |
| InChI | InChI=1S/C10H10BrF3O/c1-2-9(15,10(12,13)14)7-3-5-8(11)6-4-7/h3-6,15H,2H2,1H3/t9-/m1/s1 |
| InChIKey | YVEKDYUXTVECRA-SECBINFHSA-N |
| XLogP | 3.61 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.09 |
| LogP ≤ 5 | 3.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |