C21H15Cl2N7 — CID 10238243
5-[2-[[2-(2,4-dichlorophenyl)pyrido[3,2-d]pyrimidin-4-yl]amino]ethylamino]pyridine-2-carbonitrile (PubChem CID 10238243) has the molecular formula C21H15Cl2N7 and a molecular weight of 436.31 g/mol. Its IUPAC name is 5-[2-[[2-(2,4-dichlorophenyl)pyrido[3,2-d]pyrimidin-4-yl]amino]ethylamino]pyridine-2-carbonitrile.
| Compound Name | 5-[2-[[2-(2,4-dichlorophenyl)pyrido[3,2-d]pyrimidin-4-yl]amino]ethylamino]pyridine-2-carbonitrile |
|---|---|
| PubChem CID | 10238243 |
| Molecular Formula | C21H15Cl2N7 |
| Molecular Weight | 436.31 g/mol |
| Exact Mass | 435.08 |
| IUPAC Name | 5-[2-[[2-(2,4-dichlorophenyl)pyrido[3,2-d]pyrimidin-4-yl]amino]ethylamino]pyridine-2-carbonitrile |
| SMILES | N#Cc1ccc(NCCNc2nc(-c3ccc(Cl)cc3Cl)nc3cccnc23)cn1 |
| InChI | InChI=1S/C21H15Cl2N7/c22-13-3-6-16(17(23)10-13)20-29-18-2-1-7-26-19(18)21(30-20)27-9-8-25-15-5-4-14(11-24)28-12-15/h1-7,10,12,25H,8-9H2,(H,27,29,30) |
| InChIKey | GVSJRDUJXRAYEL-UHFFFAOYSA-N |
| XLogP | 4.79 |
| TPSA | 99.41 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.31 |
| LogP ≤ 5 | 4.79 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|