C40H40N4O2 — CID 102382448
4,4,5,5-tetramethyl-2-[4-[10-[4-(4,4,5,5-tetramethyl-1-oxidoimidazol-2-yl)phenyl]anthracen-1-yl]phenyl]imidazol-1-ium 1-oxide (PubChem CID 102382448) has the molecular formula C40H40N4O2 and a molecular weight of 608.79 g/mol. Its IUPAC name is 4,4,5,5-tetramethyl-2-[4-[10-[4-(4,4,5,5-tetramethyl-1-oxidoimidazol-2-yl)phenyl]anthracen-1-yl]phenyl]imidazol-1-ium 1-oxide.
| Compound Name | 4,4,5,5-tetramethyl-2-[4-[10-[4-(4,4,5,5-tetramethyl-1-oxidoimidazol-2-yl)phenyl]anthracen-1-yl]phenyl]imidazol-1-ium 1-oxide |
|---|---|
| PubChem CID | 102382448 |
| Molecular Formula | C40H40N4O2 |
| Molecular Weight | 608.79 g/mol |
| Exact Mass | 608.32 |
| IUPAC Name | 4,4,5,5-tetramethyl-2-[4-[10-[4-(4,4,5,5-tetramethyl-1-oxidoimidazol-2-yl)phenyl]anthracen-1-yl]phenyl]imidazol-1-ium 1-oxide |
| SMILES | CC1(C)N=C(c2ccc(-c3c4ccccc4cc4c(-c5ccc(C6=NC(C)(C)C(C)(C)[N+]6=O)cc5)cccc34)cc2)N([O-])C1(C)C |
| InChI | InChI=1S/C40H40N4O2/c1-37(2)39(5,6)43(45)35(41-37)27-20-16-25(17-21-27)30-14-11-15-32-33(30)24-29-12-9-10-13-31(29)34(32)26-18-22-28(23-19-26)36-42-38(3,4)40(7,8)44(36)46/h9-24H,1-8H3 |
| InChIKey | HULFKKNCBDBSGG-UHFFFAOYSA-N |
| XLogP | 9.54 |
| TPSA | 71.10 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 608.79 |
| LogP ≤ 5 | 9.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|