C24H42O5Si — CID 10238290
(9E,15E)-12-[tert-butyl(dimethyl)silyl]oxy-1,4-dioxacycloicosa-9,15-diene-8,17-dione (PubChem CID 10238290) has the molecular formula C24H42O5Si and a molecular weight of 438.68 g/mol. Its IUPAC name is (9E,15E)-12-[tert-butyl(dimethyl)silyl]oxy-1,4-dioxacycloicosa-9,15-diene-8,17-dione.
| Compound Name | (9E,15E)-12-[tert-butyl(dimethyl)silyl]oxy-1,4-dioxacycloicosa-9,15-diene-8,17-dione |
|---|---|
| PubChem CID | 10238290 |
| Molecular Formula | C24H42O5Si |
| Molecular Weight | 438.68 g/mol |
| Exact Mass | 438.28 |
| IUPAC Name | (9E,15E)-12-[tert-butyl(dimethyl)silyl]oxy-1,4-dioxacycloicosa-9,15-diene-8,17-dione |
| SMILES | CC(C)(C)[Si](C)(C)OC1C/C=C/C(=O)CCCOCCOCCCC(=O)/C=C/CC1 |
| InChI | InChI=1S/C24H42O5Si/c1-24(2,3)30(4,5)29-23-15-7-6-11-21(25)13-9-17-27-19-20-28-18-10-14-22(26)12-8-16-23/h6,8,11-12,23H,7,9-10,13-20H2,1-5H3/b11-6+,12-8+ |
| InChIKey | CIAAMRSTQMIEBE-DECBNBDHSA-N |
| XLogP | 5.40 |
| TPSA | 61.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.68 |
| LogP ≤ 5 | 5.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|