C41H78O17P2 — CID 102383106
[(2R)-3-[[3-[[(2R)-2,3-di(octanoyloxy)propoxy]-hydroxyphosphoryl]oxy-2-hydroxypropoxy]-hydroxyphosphoryl]oxy-2-octanoyloxypropyl] octanoate (PubChem CID 102383106) has the molecular formula C41H78O17P2 and a molecular weight of 905.01 g/mol. Its IUPAC name is [(2R)-3-[[3-[[(2R)-2,3-di(octanoyloxy)propoxy]-hydroxyphosphoryl]oxy-2-hydroxypropoxy]-hydroxyphosphoryl]oxy-2-octanoyloxypropyl] octanoate.
| Compound Name | [(2R)-3-[[3-[[(2R)-2,3-di(octanoyloxy)propoxy]-hydroxyphosphoryl]oxy-2-hydroxypropoxy]-hydroxyphosphoryl]oxy-2-octanoyloxypropyl] octanoate |
|---|---|
| PubChem CID | 102383106 |
| Molecular Formula | C41H78O17P2 |
| Molecular Weight | 905.01 g/mol |
| Exact Mass | 904.47 |
| IUPAC Name | [(2R)-3-[[3-[[(2R)-2,3-di(octanoyloxy)propoxy]-hydroxyphosphoryl]oxy-2-hydroxypropoxy]-hydroxyphosphoryl]oxy-2-octanoyloxypropyl] octanoate |
| SMILES | CCCCCCCC(=O)OC[C@H](COP(=O)(O)OCC(O)COP(=O)(O)OC[C@@H](COC(=O)CCCCCCC)OC(=O)CCCCCCC)OC(=O)CCCCCCC |
| InChI | InChI=1S/C41H78O17P2/c1-5-9-13-17-21-25-38(43)51-31-36(57-40(45)27-23-19-15-11-7-3)33-55-59(47,48)53-29-35(42)30-54-60(49,50)56-34-37(58-41(46)28-24-20-16-12-8-4)32-52-39(44)26-22-18-14-10-6-2/h35-37,42H,5-34H2,1-4H3,(H,47,48)(H,49,50)/t36-,37-/m1/s1 |
| InChIKey | PVSPUBLWCTXHDH-FZNHDDJXSA-N |
| XLogP | 8.97 |
| TPSA | 236.95 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 15 |
| Rotatable Bonds | 42 |
| Heavy Atoms | 60 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 905.01 |
| LogP ≤ 5 | 8.97 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 15 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|