C14H17N3O4 — CID 102383285
methyl 2-[(2R,3aS)-4-oxo-2-pyridin-4-yl-3,3a,6,7-tetrahydro-2H-[1,2]oxazolo[2,3-a]pyrazin-5-yl]acetate (PubChem CID 102383285) has the molecular formula C14H17N3O4 and a molecular weight of 291.31 g/mol. Its IUPAC name is methyl 2-[(2R,3aS)-4-oxo-2-pyridin-4-yl-3,3a,6,7-tetrahydro-2H-[1,2]oxazolo[2,3-a]pyrazin-5-yl]acetate.
| Compound Name | methyl 2-[(2R,3aS)-4-oxo-2-pyridin-4-yl-3,3a,6,7-tetrahydro-2H-[1,2]oxazolo[2,3-a]pyrazin-5-yl]acetate |
|---|---|
| PubChem CID | 102383285 |
| Molecular Formula | C14H17N3O4 |
| Molecular Weight | 291.31 g/mol |
| Exact Mass | 291.12 |
| IUPAC Name | methyl 2-[(2R,3aS)-4-oxo-2-pyridin-4-yl-3,3a,6,7-tetrahydro-2H-[1,2]oxazolo[2,3-a]pyrazin-5-yl]acetate |
| SMILES | COC(=O)CN1CCN2O[C@@H](c3ccncc3)C[C@H]2C1=O |
| InChI | InChI=1S/C14H17N3O4/c1-20-13(18)9-16-6-7-17-11(14(16)19)8-12(21-17)10-2-4-15-5-3-10/h2-5,11-12H,6-9H2,1H3/t11-,12+/m0/s1 |
| InChIKey | CMWGAXZTDPQKEW-NWDGAFQWSA-N |
| XLogP | 0.14 |
| TPSA | 71.97 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.31 |
| LogP ≤ 5 | 0.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |