About 6-tert-butyl-2-phenyl-2,3-dihydrothiopyran-4-one
6-tert-butyl-2-phenyl-2,3-dihydrothiopyran-4-one (PubChem CID 102383505) has the molecular formula C15H18OS
and a molecular weight of 246.38 g/mol. Its IUPAC name is 6-tert-butyl-2-phenyl-2,3-dihydrothiopyran-4-one.
Molecular Properties
| Compound Name | 6-tert-butyl-2-phenyl-2,3-dihydrothiopyran-4-one |
| PubChem CID | 102383505 |
| Molecular Formula | C15H18OS |
| Molecular Weight | 246.38 g/mol |
| Exact Mass | 246.11 |
| IUPAC Name | 6-tert-butyl-2-phenyl-2,3-dihydrothiopyran-4-one |
| SMILES | CC(C)(C)C1=CC(=O)CC(c2ccccc2)S1 |
| InChI | InChI=1S/C15H18OS/c1-15(2,3)14-10-12(16)9-13(17-14)11-7-5-4-6-8-11/h4-8,10,13H,9H2,1-3H3 |
| InChIKey | NMOHCPUDLVKCSV-UHFFFAOYSA-N |
| XLogP | 4.36 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 246.38 |
| LogP ≤ 5 | 4.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 6-tert-butyl-2-phenyl-2,3-dihydrothiopyran-4-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-tert-butyl-2-phenyl-2,3-dihydrothiopyran-4-one?
The IUPAC name of 6-tert-butyl-2-phenyl-2,3-dihydrothiopyran-4-one (CID 102383505) is 6-tert-butyl-2-phenyl-2,3-dihydrothiopyran-4-one.
What is the SMILES notation for 6-tert-butyl-2-phenyl-2,3-dihydrothiopyran-4-one?
The canonical SMILES for 6-tert-butyl-2-phenyl-2,3-dihydrothiopyran-4-one is CC(C)(C)C1=CC(=O)CC(c2ccccc2)S1.
What is the InChIKey of 6-tert-butyl-2-phenyl-2,3-dihydrothiopyran-4-one?
The InChIKey is NMOHCPUDLVKCSV-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H18OS/c1-15(2,3)14-10-12(16)9-13(17-14)11-7-5-4-6-8-11/h4-8,10,13H,9H2,1-3H3.
What are the key properties of 6-tert-butyl-2-phenyl-2,3-dihydrothiopyran-4-one?
6-tert-butyl-2-phenyl-2,3-dihydrothiopyran-4-one has a molecular weight of 246.38 g/mol, XLogP of 4.36, 1 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 6-tert-butyl-2-phenyl-2,3-dihydrothiopyran-4-one is sourced from PubChem (CID 102383505), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).