About 2-phenylsulfanyl-N,N-di(propan-2-yl)cyclopenta-2,4-diene-1-carboxamide
2-phenylsulfanyl-N,N-di(propan-2-yl)cyclopenta-2,4-diene-1-carboxamide (PubChem CID 102383514) has the molecular formula C18H23NOS
and a molecular weight of 301.45 g/mol. Its IUPAC name is 2-phenylsulfanyl-N,N-di(propan-2-yl)cyclopenta-2,4-diene-1-carboxamide.
Molecular Properties
| Compound Name | 2-phenylsulfanyl-N,N-di(propan-2-yl)cyclopenta-2,4-diene-1-carboxamide |
| PubChem CID | 102383514 |
| Molecular Formula | C18H23NOS |
| Molecular Weight | 301.45 g/mol |
| Exact Mass | 301.15 |
| IUPAC Name | 2-phenylsulfanyl-N,N-di(propan-2-yl)cyclopenta-2,4-diene-1-carboxamide |
| SMILES | CC(C)N(C(=O)C1C=CC=C1Sc1ccccc1)C(C)C |
| InChI | InChI=1S/C18H23NOS/c1-13(2)19(14(3)4)18(20)16-11-8-12-17(16)21-15-9-6-5-7-10-15/h5-14,16H,1-4H3 |
| InChIKey | OCZBPZPPONMCAA-UHFFFAOYSA-N |
| XLogP | 4.49 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 301.45 |
| LogP ≤ 5 | 4.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 2-phenylsulfanyl-N,N-di(propan-2-yl)cyclopenta-2,4-diene-1-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-phenylsulfanyl-N,N-di(propan-2-yl)cyclopenta-2,4-diene-1-carboxamide?
The IUPAC name of 2-phenylsulfanyl-N,N-di(propan-2-yl)cyclopenta-2,4-diene-1-carboxamide (CID 102383514) is 2-phenylsulfanyl-N,N-di(propan-2-yl)cyclopenta-2,4-diene-1-carboxamide.
What is the SMILES notation for 2-phenylsulfanyl-N,N-di(propan-2-yl)cyclopenta-2,4-diene-1-carboxamide?
The canonical SMILES for 2-phenylsulfanyl-N,N-di(propan-2-yl)cyclopenta-2,4-diene-1-carboxamide is CC(C)N(C(=O)C1C=CC=C1Sc1ccccc1)C(C)C.
What is the InChIKey of 2-phenylsulfanyl-N,N-di(propan-2-yl)cyclopenta-2,4-diene-1-carboxamide?
The InChIKey is OCZBPZPPONMCAA-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H23NOS/c1-13(2)19(14(3)4)18(20)16-11-8-12-17(16)21-15-9-6-5-7-10-15/h5-14,16H,1-4H3.
What are the key properties of 2-phenylsulfanyl-N,N-di(propan-2-yl)cyclopenta-2,4-diene-1-carboxamide?
2-phenylsulfanyl-N,N-di(propan-2-yl)cyclopenta-2,4-diene-1-carboxamide has a molecular weight of 301.45 g/mol, XLogP of 4.49, 5 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-phenylsulfanyl-N,N-di(propan-2-yl)cyclopenta-2,4-diene-1-carboxamide is sourced from PubChem (CID 102383514), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).