C24H60Si8 — CID 102383723
tert-butyl-dimethyl-[2,3,4-tris[tert-butyl(dimethyl)silyl]tetrasilet-1-yl]silane (PubChem CID 102383723) has the molecular formula C24H60Si8 and a molecular weight of 573.43 g/mol. Its IUPAC name is tert-butyl-dimethyl-[2,3,4-tris[tert-butyl(dimethyl)silyl]tetrasilet-1-yl]silane.
| Compound Name | tert-butyl-dimethyl-[2,3,4-tris[tert-butyl(dimethyl)silyl]tetrasilet-1-yl]silane |
|---|---|
| PubChem CID | 102383723 |
| Molecular Formula | C24H60Si8 |
| Molecular Weight | 573.43 g/mol |
| Exact Mass | 572.28 |
| IUPAC Name | tert-butyl-dimethyl-[2,3,4-tris[tert-butyl(dimethyl)silyl]tetrasilet-1-yl]silane |
| SMILES | CC(C)(C)[Si](C)(C)[Si]1=[Si]([Si](C)(C)C(C)(C)C)[Si]([Si](C)(C)C(C)(C)C)=[Si]1[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C24H60Si8/c1-21(2,3)29(13,14)25-26(30(15,16)22(4,5)6)28(32(19,20)24(10,11)12)27(25)31(17,18)23(7,8)9/h1-20H3 |
| InChIKey | YFAYNYPBKMVRQX-UHFFFAOYSA-N |
| XLogP | 8.64 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 573.43 |
| LogP ≤ 5 | 8.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|