C19H34O3Si — CID 102384072
[(E,4S)-4-[tert-butyl(dimethyl)silyl]oxy-3-methyldec-2-en-7-ynyl] acetate (PubChem CID 102384072) has the molecular formula C19H34O3Si and a molecular weight of 338.56 g/mol. Its IUPAC name is [(E,4S)-4-[tert-butyl(dimethyl)silyl]oxy-3-methyldec-2-en-7-ynyl] acetate.
| Compound Name | [(E,4S)-4-[tert-butyl(dimethyl)silyl]oxy-3-methyldec-2-en-7-ynyl] acetate |
|---|---|
| PubChem CID | 102384072 |
| Molecular Formula | C19H34O3Si |
| Molecular Weight | 338.56 g/mol |
| Exact Mass | 338.23 |
| IUPAC Name | [(E,4S)-4-[tert-butyl(dimethyl)silyl]oxy-3-methyldec-2-en-7-ynyl] acetate |
| SMILES | CCC#CCC[C@H](O[Si](C)(C)C(C)(C)C)/C(C)=C/COC(C)=O |
| InChI | InChI=1S/C19H34O3Si/c1-9-10-11-12-13-18(16(2)14-15-21-17(3)20)22-23(7,8)19(4,5)6/h14,18H,9,12-13,15H2,1-8H3/b16-14+/t18-/m0/s1 |
| InChIKey | RESHYZVNSXWNEF-ZWFBASDOSA-N |
| XLogP | 5.08 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.56 |
| LogP ≤ 5 | 5.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|