About [(E,4S)-4-[tert-butyl(dimethyl)silyl]oxy-3-methyl-8-trimethylsilyloct-2-en-7-ynyl] acetate
[(E,4S)-4-[tert-butyl(dimethyl)silyl]oxy-3-methyl-8-trimethylsilyloct-2-en-7-ynyl] acetate (PubChem CID 102384082) has the molecular formula C20H38O3Si2
and a molecular weight of 382.69 g/mol. Its IUPAC name is [(E,4S)-4-[tert-butyl(dimethyl)silyl]oxy-3-methyl-8-trimethylsilyloct-2-en-7-ynyl] acetate.
Molecular Properties
| Compound Name | [(E,4S)-4-[tert-butyl(dimethyl)silyl]oxy-3-methyl-8-trimethylsilyloct-2-en-7-ynyl] acetate |
| PubChem CID | 102384082 |
| Molecular Formula | C20H38O3Si2 |
| Molecular Weight | 382.69 g/mol |
| Exact Mass | 382.24 |
| IUPAC Name | [(E,4S)-4-[tert-butyl(dimethyl)silyl]oxy-3-methyl-8-trimethylsilyloct-2-en-7-ynyl] acetate |
| SMILES | CC(=O)OC/C=C(\C)[C@H](CCC#C[Si](C)(C)C)O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C20H38O3Si2/c1-17(14-15-22-18(2)21)19(13-11-12-16-24(6,7)8)23-25(9,10)20(3,4)5/h14,19H,11,13,15H2,1-10H3/b17-14+/t19-/m0/s1 |
| InChIKey | UMIRNIPCNGFKMB-FLXZHSAZSA-N |
| XLogP | 5.55 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 382.69 |
| LogP ≤ 5 | 5.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|
Analyze [(E,4S)-4-[tert-butyl(dimethyl)silyl]oxy-3-methyl-8-trimethylsilyloct-2-en-7-ynyl] acetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [(E,4S)-4-[tert-butyl(dimethyl)silyl]oxy-3-methyl-8-trimethylsilyloct-2-en-7-ynyl] acetate?
The IUPAC name of [(E,4S)-4-[tert-butyl(dimethyl)silyl]oxy-3-methyl-8-trimethylsilyloct-2-en-7-ynyl] acetate (CID 102384082) is [(E,4S)-4-[tert-butyl(dimethyl)silyl]oxy-3-methyl-8-trimethylsilyloct-2-en-7-ynyl] acetate.
What is the SMILES notation for [(E,4S)-4-[tert-butyl(dimethyl)silyl]oxy-3-methyl-8-trimethylsilyloct-2-en-7-ynyl] acetate?
The canonical SMILES for [(E,4S)-4-[tert-butyl(dimethyl)silyl]oxy-3-methyl-8-trimethylsilyloct-2-en-7-ynyl] acetate is CC(=O)OC/C=C(\C)[C@H](CCC#C[Si](C)(C)C)O[Si](C)(C)C(C)(C)C.
What is the InChIKey of [(E,4S)-4-[tert-butyl(dimethyl)silyl]oxy-3-methyl-8-trimethylsilyloct-2-en-7-ynyl] acetate?
The InChIKey is UMIRNIPCNGFKMB-FLXZHSAZSA-N. The full InChI is InChI=1S/C20H38O3Si2/c1-17(14-15-22-18(2)21)19(13-11-12-16-24(6,7)8)23-25(9,10)20(3,4)5/h14,19H,11,13,15H2,1-10H3/b17-14+/t19-/m0/s1.
What are the key properties of [(E,4S)-4-[tert-butyl(dimethyl)silyl]oxy-3-methyl-8-trimethylsilyloct-2-en-7-ynyl] acetate?
[(E,4S)-4-[tert-butyl(dimethyl)silyl]oxy-3-methyl-8-trimethylsilyloct-2-en-7-ynyl] acetate has a molecular weight of 382.69 g/mol, XLogP of 5.55, 7 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for [(E,4S)-4-[tert-butyl(dimethyl)silyl]oxy-3-methyl-8-trimethylsilyloct-2-en-7-ynyl] acetate is sourced from PubChem (CID 102384082), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).