C15H29NO4 — CID 102385119
(1S,2S,3R,6S)-4-(hydroxymethyl)-6-(octylamino)cyclohex-4-ene-1,2,3-triol (PubChem CID 102385119) has the molecular formula C15H29NO4 and a molecular weight of 287.40 g/mol. Its IUPAC name is (1S,2S,3R,6S)-4-(hydroxymethyl)-6-(octylamino)cyclohex-4-ene-1,2,3-triol.
| Compound Name | (1S,2S,3R,6S)-4-(hydroxymethyl)-6-(octylamino)cyclohex-4-ene-1,2,3-triol |
|---|---|
| PubChem CID | 102385119 |
| Molecular Formula | C15H29NO4 |
| Molecular Weight | 287.40 g/mol |
| Exact Mass | 287.21 |
| IUPAC Name | (1S,2S,3R,6S)-4-(hydroxymethyl)-6-(octylamino)cyclohex-4-ene-1,2,3-triol |
| SMILES | CCCCCCCCN[C@H]1C=C(CO)[C@@H](O)[C@H](O)[C@H]1O |
| InChI | InChI=1S/C15H29NO4/c1-2-3-4-5-6-7-8-16-12-9-11(10-17)13(18)15(20)14(12)19/h9,12-20H,2-8,10H2,1H3/t12-,13+,14-,15-/m0/s1 |
| InChIKey | UPZUHYMBTUUPML-XGUBFFRZSA-N |
| XLogP | 0.32 |
| TPSA | 92.95 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.40 |
| LogP ≤ 5 | 0.32 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|