C21H19Br2NO2 — CID 102385253
ethyl 4-(2-benzyl-5-methylpyrrol-1-yl)-3,5-dibromobenzoate (PubChem CID 102385253) has the molecular formula C21H19Br2NO2 and a molecular weight of 477.20 g/mol. Its IUPAC name is ethyl 4-(2-benzyl-5-methylpyrrol-1-yl)-3,5-dibromobenzoate.
| Compound Name | ethyl 4-(2-benzyl-5-methylpyrrol-1-yl)-3,5-dibromobenzoate |
|---|---|
| PubChem CID | 102385253 |
| Molecular Formula | C21H19Br2NO2 |
| Molecular Weight | 477.20 g/mol |
| Exact Mass | 474.98 |
| IUPAC Name | ethyl 4-(2-benzyl-5-methylpyrrol-1-yl)-3,5-dibromobenzoate |
| SMILES | CCOC(=O)c1cc(Br)c(-n2c(C)ccc2Cc2ccccc2)c(Br)c1 |
| InChI | InChI=1S/C21H19Br2NO2/c1-3-26-21(25)16-12-18(22)20(19(23)13-16)24-14(2)9-10-17(24)11-15-7-5-4-6-8-15/h4-10,12-13H,3,11H2,1-2H3 |
| InChIKey | GLZMIPNKOZVFCK-UHFFFAOYSA-N |
| XLogP | 6.08 |
| TPSA | 31.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 477.20 |
| LogP ≤ 5 | 6.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'pyrrole_A(118)', 'substructure': 'N/A'} |
|---|