C24H17N3O3 — CID 102385556
5-benzyl-5,10,20-triazapentacyclo[11.7.0.02,10.03,7.014,19]icosa-1(13),2,7,14,16,18-hexaene-4,6,9-trione (PubChem CID 102385556) has the molecular formula C24H17N3O3 and a molecular weight of 395.42 g/mol. Its IUPAC name is 5-benzyl-5,10,20-triazapentacyclo[11.7.0.02,10.03,7.014,19]icosa-1(13),2,7,14,16,18-hexaene-4,6,9-trione.
| Compound Name | 5-benzyl-5,10,20-triazapentacyclo[11.7.0.02,10.03,7.014,19]icosa-1(13),2,7,14,16,18-hexaene-4,6,9-trione |
|---|---|
| PubChem CID | 102385556 |
| Molecular Formula | C24H17N3O3 |
| Molecular Weight | 395.42 g/mol |
| Exact Mass | 395.13 |
| IUPAC Name | 5-benzyl-5,10,20-triazapentacyclo[11.7.0.02,10.03,7.014,19]icosa-1(13),2,7,14,16,18-hexaene-4,6,9-trione |
| SMILES | O=C1c2cc(=O)n3c(c2C(=O)N1Cc1ccccc1)-c1[nH]c2ccccc2c1CC3 |
| InChI | InChI=1S/C24H17N3O3/c28-19-12-17-20(24(30)27(23(17)29)13-14-6-2-1-3-7-14)22-21-16(10-11-26(19)22)15-8-4-5-9-18(15)25-21/h1-9,12,25H,10-11,13H2 |
| InChIKey | OVHHPHPQRUZAGT-UHFFFAOYSA-N |
| XLogP | 3.35 |
| TPSA | 75.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.42 |
| LogP ≤ 5 | 3.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|