C23H24N8O3 — CID 10238586
4-(furan-2-yl)-10-[2-[4-(2-methoxyethoxy)-1,3-dihydroisoindol-2-yl]ethyl]-3,5,6,8,10,11-hexazatricyclo[7.3.0.02,6]dodeca-1(9),2,4,7,11-pentaen-7-amine (PubChem CID 10238586) has the molecular formula C23H24N8O3 and a molecular weight of 460.50 g/mol. Its IUPAC name is 4-(furan-2-yl)-10-[2-[4-(2-methoxyethoxy)-1,3-dihydroisoindol-2-yl]ethyl]-3,5,6,8,10,11-hexazatricyclo[7.3.0.02,6]dodeca-1(9),2,4,7,11-pentaen-7-amine.
| Compound Name | 4-(furan-2-yl)-10-[2-[4-(2-methoxyethoxy)-1,3-dihydroisoindol-2-yl]ethyl]-3,5,6,8,10,11-hexazatricyclo[7.3.0.02,6]dodeca-1(9),2,4,7,11-pentaen-7-amine |
|---|---|
| PubChem CID | 10238586 |
| Molecular Formula | C23H24N8O3 |
| Molecular Weight | 460.50 g/mol |
| Exact Mass | 460.20 |
| IUPAC Name | 4-(furan-2-yl)-10-[2-[4-(2-methoxyethoxy)-1,3-dihydroisoindol-2-yl]ethyl]-3,5,6,8,10,11-hexazatricyclo[7.3.0.02,6]dodeca-1(9),2,4,7,11-pentaen-7-amine |
| SMILES | COCCOc1cccc2c1CN(CCn1ncc3c1nc(N)n1nc(-c4ccco4)nc31)C2 |
| InChI | InChI=1S/C23H24N8O3/c1-32-10-11-34-18-5-2-4-15-13-29(14-17(15)18)7-8-30-21-16(12-25-30)22-26-20(19-6-3-9-33-19)28-31(22)23(24)27-21/h2-6,9,12H,7-8,10-11,13-14H2,1H3,(H2,24,27) |
| InChIKey | SBZVOYPDJJFXDY-UHFFFAOYSA-N |
| XLogP | 2.36 |
| TPSA | 121.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 460.50 |
| LogP ≤ 5 | 2.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|