C18H25F3O7S — CID 102385987
methyl 3-[2-(2,2-dimethyl-4H-1,3-dioxin-6-yl)ethyl]-3-methyl-2-(trifluoromethylsulfonyloxy)cyclohexene-1-carboxylate (PubChem CID 102385987) has the molecular formula C18H25F3O7S and a molecular weight of 442.45 g/mol. Its IUPAC name is methyl 3-[2-(2,2-dimethyl-4H-1,3-dioxin-6-yl)ethyl]-3-methyl-2-(trifluoromethylsulfonyloxy)cyclohexene-1-carboxylate.
| Compound Name | methyl 3-[2-(2,2-dimethyl-4H-1,3-dioxin-6-yl)ethyl]-3-methyl-2-(trifluoromethylsulfonyloxy)cyclohexene-1-carboxylate |
|---|---|
| PubChem CID | 102385987 |
| Molecular Formula | C18H25F3O7S |
| Molecular Weight | 442.45 g/mol |
| Exact Mass | 442.13 |
| IUPAC Name | methyl 3-[2-(2,2-dimethyl-4H-1,3-dioxin-6-yl)ethyl]-3-methyl-2-(trifluoromethylsulfonyloxy)cyclohexene-1-carboxylate |
| SMILES | COC(=O)C1=C(OS(=O)(=O)C(F)(F)F)C(C)(CCC2=CCOC(C)(C)O2)CCC1 |
| InChI | InChI=1S/C18H25F3O7S/c1-16(2)26-11-8-12(27-16)7-10-17(3)9-5-6-13(15(22)25-4)14(17)28-29(23,24)18(19,20)21/h8H,5-7,9-11H2,1-4H3 |
| InChIKey | JUJLEVXMEGVSFO-UHFFFAOYSA-N |
| XLogP | 3.92 |
| TPSA | 88.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.45 |
| LogP ≤ 5 | 3.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'}, {'alert_name': 'triflate', 'substructure': 'N/A'} |
|---|