C14H20I2O3 — CID 102386340
ethyl (9Z)-9-iodo-2-(iodomethyl)-3,4,5,6,7,8-hexahydro-2H-cycloocta[b]furan-3a-carboxylate (PubChem CID 102386340) has the molecular formula C14H20I2O3 and a molecular weight of 490.12 g/mol. Its IUPAC name is ethyl (9Z)-9-iodo-2-(iodomethyl)-3,4,5,6,7,8-hexahydro-2H-cycloocta[b]furan-3a-carboxylate.
| Compound Name | ethyl (9Z)-9-iodo-2-(iodomethyl)-3,4,5,6,7,8-hexahydro-2H-cycloocta[b]furan-3a-carboxylate |
|---|---|
| PubChem CID | 102386340 |
| Molecular Formula | C14H20I2O3 |
| Molecular Weight | 490.12 g/mol |
| Exact Mass | 489.95 |
| IUPAC Name | ethyl (9Z)-9-iodo-2-(iodomethyl)-3,4,5,6,7,8-hexahydro-2H-cycloocta[b]furan-3a-carboxylate |
| SMILES | CCOC(=O)C12CCCCC/C(I)=C\1OC(CI)C2 |
| InChI | InChI=1S/C14H20I2O3/c1-2-18-13(17)14-7-5-3-4-6-11(16)12(14)19-10(8-14)9-15/h10H,2-9H2,1H3/b12-11- |
| InChIKey | SXPRZAKTNGTKAN-QXMHVHEDSA-N |
| XLogP | 4.37 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 490.12 |
| LogP ≤ 5 | 4.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|