C10H12ClN3O3 — CID 102386626
7a-[(6-chloropyridazin-3-yl)oxymethyl]-1,3,5,7-tetrahydro-[1,3]oxazolo[3,4-c][1,3]oxazole (PubChem CID 102386626) has the molecular formula C10H12ClN3O3 and a molecular weight of 257.68 g/mol. Its IUPAC name is 7a-[(6-chloropyridazin-3-yl)oxymethyl]-1,3,5,7-tetrahydro-[1,3]oxazolo[3,4-c][1,3]oxazole.
| Compound Name | 7a-[(6-chloropyridazin-3-yl)oxymethyl]-1,3,5,7-tetrahydro-[1,3]oxazolo[3,4-c][1,3]oxazole |
|---|---|
| PubChem CID | 102386626 |
| Molecular Formula | C10H12ClN3O3 |
| Molecular Weight | 257.68 g/mol |
| Exact Mass | 257.06 |
| IUPAC Name | 7a-[(6-chloropyridazin-3-yl)oxymethyl]-1,3,5,7-tetrahydro-[1,3]oxazolo[3,4-c][1,3]oxazole |
| SMILES | Clc1ccc(OCC23COCN2COC3)nn1 |
| InChI | InChI=1S/C10H12ClN3O3/c11-8-1-2-9(13-12-8)17-5-10-3-15-6-14(10)7-16-4-10/h1-2H,3-7H2 |
| InChIKey | JMALIWSSQZFRAO-UHFFFAOYSA-N |
| XLogP | 0.52 |
| TPSA | 56.71 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 257.68 |
| LogP ≤ 5 | 0.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |