C12H12F3NO3 — CID 102386688
3-[(1S,2R,3R,4R)-3-(trifluoromethyl)bicyclo[2.2.1]hept-5-ene-2-carbonyl]-1,3-oxazolidin-2-one (PubChem CID 102386688) has the molecular formula C12H12F3NO3 and a molecular weight of 275.23 g/mol. Its IUPAC name is 3-[(1S,2R,3R,4R)-3-(trifluoromethyl)bicyclo[2.2.1]hept-5-ene-2-carbonyl]-1,3-oxazolidin-2-one.
| Compound Name | 3-[(1S,2R,3R,4R)-3-(trifluoromethyl)bicyclo[2.2.1]hept-5-ene-2-carbonyl]-1,3-oxazolidin-2-one |
|---|---|
| PubChem CID | 102386688 |
| Molecular Formula | C12H12F3NO3 |
| Molecular Weight | 275.23 g/mol |
| Exact Mass | 275.08 |
| IUPAC Name | 3-[(1S,2R,3R,4R)-3-(trifluoromethyl)bicyclo[2.2.1]hept-5-ene-2-carbonyl]-1,3-oxazolidin-2-one |
| SMILES | O=C1OCCN1C(=O)[C@H]1[C@H](C(F)(F)F)[C@H]2C=C[C@@H]1C2 |
| InChI | InChI=1S/C12H12F3NO3/c13-12(14,15)9-7-2-1-6(5-7)8(9)10(17)16-3-4-19-11(16)18/h1-2,6-9H,3-5H2/t6-,7+,8-,9-/m1/s1 |
| InChIKey | BVQNHGSHTIKHHJ-BZNPZCIMSA-N |
| XLogP | 1.97 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 275.23 |
| LogP ≤ 5 | 1.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|