About 4,5-dibromo-2,6-diphenylpyrimidine
4,5-dibromo-2,6-diphenylpyrimidine (PubChem CID 1023869) has the molecular formula C16H10Br2N2
and a molecular weight of 390.08 g/mol. Its IUPAC name is 4,5-dibromo-2,6-diphenylpyrimidine.
Molecular Properties
| Compound Name | 4,5-dibromo-2,6-diphenylpyrimidine |
| PubChem CID | 1023869 |
| Molecular Formula | C16H10Br2N2 |
| Molecular Weight | 390.08 g/mol |
| Exact Mass | 387.92 |
| IUPAC Name | 4,5-dibromo-2,6-diphenylpyrimidine |
| SMILES | Brc1nc(-c2ccccc2)nc(-c2ccccc2)c1Br |
| InChI | InChI=1S/C16H10Br2N2/c17-13-14(11-7-3-1-4-8-11)19-16(20-15(13)18)12-9-5-2-6-10-12/h1-10H |
| InChIKey | GSCMITZZYYFEGP-UHFFFAOYSA-N |
| XLogP | 5.34 |
| TPSA | 25.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 390.08 |
| LogP ≤ 5 | 5.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 4,5-dibromo-2,6-diphenylpyrimidine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4,5-dibromo-2,6-diphenylpyrimidine?
The IUPAC name of 4,5-dibromo-2,6-diphenylpyrimidine (CID 1023869) is 4,5-dibromo-2,6-diphenylpyrimidine.
What is the SMILES notation for 4,5-dibromo-2,6-diphenylpyrimidine?
The canonical SMILES for 4,5-dibromo-2,6-diphenylpyrimidine is Brc1nc(-c2ccccc2)nc(-c2ccccc2)c1Br.
What is the InChIKey of 4,5-dibromo-2,6-diphenylpyrimidine?
The InChIKey is GSCMITZZYYFEGP-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H10Br2N2/c17-13-14(11-7-3-1-4-8-11)19-16(20-15(13)18)12-9-5-2-6-10-12/h1-10H.
What are the key properties of 4,5-dibromo-2,6-diphenylpyrimidine?
4,5-dibromo-2,6-diphenylpyrimidine has a molecular weight of 390.08 g/mol, XLogP of 5.34, 2 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 4,5-dibromo-2,6-diphenylpyrimidine is sourced from PubChem (CID 1023869), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).