C10H10I2O4 — CID 102386942
5,7-diiodotricyclo[3.3.0.03,7]octane-1,3-dicarboxylic acid (PubChem CID 102386942) has the molecular formula C10H10I2O4 and a molecular weight of 447.99 g/mol. Its IUPAC name is 5,7-diiodotricyclo[3.3.0.03,7]octane-1,3-dicarboxylic acid.
| Compound Name | 5,7-diiodotricyclo[3.3.0.03,7]octane-1,3-dicarboxylic acid |
|---|---|
| PubChem CID | 102386942 |
| Molecular Formula | C10H10I2O4 |
| Molecular Weight | 447.99 g/mol |
| Exact Mass | 447.87 |
| IUPAC Name | 5,7-diiodotricyclo[3.3.0.03,7]octane-1,3-dicarboxylic acid |
| SMILES | O=C(O)C12CC3(I)CC1(I)CC3(C(=O)O)C2 |
| InChI | InChI=1S/C10H10I2O4/c11-9-2-7(5(13)14)1-8(9,6(15)16)3-10(7,12)4-9/h1-4H2,(H,13,14)(H,15,16) |
| InChIKey | JTONJXBARVRYBA-UHFFFAOYSA-N |
| XLogP | 2.08 |
| TPSA | 74.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 447.99 |
| LogP ≤ 5 | 2.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|