C14H20N2O3 — CID 102386977
(2S,3S)-3-hydroxy-1-[(4-methoxyphenyl)methyl]piperidine-2-carboxamide (PubChem CID 102386977) has the molecular formula C14H20N2O3 and a molecular weight of 264.32 g/mol. Its IUPAC name is (2S,3S)-3-hydroxy-1-[(4-methoxyphenyl)methyl]piperidine-2-carboxamide.
| Compound Name | (2S,3S)-3-hydroxy-1-[(4-methoxyphenyl)methyl]piperidine-2-carboxamide |
|---|---|
| PubChem CID | 102386977 |
| Molecular Formula | C14H20N2O3 |
| Molecular Weight | 264.32 g/mol |
| Exact Mass | 264.15 |
| IUPAC Name | (2S,3S)-3-hydroxy-1-[(4-methoxyphenyl)methyl]piperidine-2-carboxamide |
| SMILES | COc1ccc(CN2CCC[C@H](O)[C@H]2C(N)=O)cc1 |
| InChI | InChI=1S/C14H20N2O3/c1-19-11-6-4-10(5-7-11)9-16-8-2-3-12(17)13(16)14(15)18/h4-7,12-13,17H,2-3,8-9H2,1H3,(H2,15,18)/t12-,13-/m0/s1 |
| InChIKey | HBBBACWUZJWIHL-STQMWFEESA-N |
| XLogP | 0.51 |
| TPSA | 75.79 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.32 |
| LogP ≤ 5 | 0.51 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |