C10H13FO4 — CID 102387093
ethyl (1R,2R,5S)-2-fluoro-3-oxo-8-oxabicyclo[3.2.1]octane-2-carboxylate (PubChem CID 102387093) has the molecular formula C10H13FO4 and a molecular weight of 216.21 g/mol. Its IUPAC name is ethyl (1R,2R,5S)-2-fluoro-3-oxo-8-oxabicyclo[3.2.1]octane-2-carboxylate.
| Compound Name | ethyl (1R,2R,5S)-2-fluoro-3-oxo-8-oxabicyclo[3.2.1]octane-2-carboxylate |
|---|---|
| PubChem CID | 102387093 |
| Molecular Formula | C10H13FO4 |
| Molecular Weight | 216.21 g/mol |
| Exact Mass | 216.08 |
| IUPAC Name | ethyl (1R,2R,5S)-2-fluoro-3-oxo-8-oxabicyclo[3.2.1]octane-2-carboxylate |
| SMILES | CCOC(=O)[C@]1(F)C(=O)C[C@@H]2CC[C@H]1O2 |
| InChI | InChI=1S/C10H13FO4/c1-2-14-9(13)10(11)7(12)5-6-3-4-8(10)15-6/h6,8H,2-5H2,1H3/t6-,8+,10-/m0/s1 |
| InChIKey | ABLLSMPSWRZHNH-IONOHQLYSA-N |
| XLogP | 0.78 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 216.21 |
| LogP ≤ 5 | 0.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|