About diethyl 2-nonylpentanedioate
diethyl 2-nonylpentanedioate (PubChem CID 102387144) has the molecular formula C18H34O4
and a molecular weight of 314.47 g/mol. Its IUPAC name is diethyl 2-nonylpentanedioate.
Molecular Properties
| Compound Name | diethyl 2-nonylpentanedioate |
| PubChem CID | 102387144 |
| Molecular Formula | C18H34O4 |
| Molecular Weight | 314.47 g/mol |
| Exact Mass | 314.25 |
| IUPAC Name | diethyl 2-nonylpentanedioate |
| SMILES | CCCCCCCCCC(CCC(=O)OCC)C(=O)OCC |
| InChI | InChI=1S/C18H34O4/c1-4-7-8-9-10-11-12-13-16(18(20)22-6-3)14-15-17(19)21-5-2/h16H,4-15H2,1-3H3 |
| InChIKey | AAIRJZMJWWKTPX-UHFFFAOYSA-N |
| XLogP | 4.65 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 314.47 |
| LogP ≤ 5 | 4.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze diethyl 2-nonylpentanedioate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of diethyl 2-nonylpentanedioate?
The IUPAC name of diethyl 2-nonylpentanedioate (CID 102387144) is diethyl 2-nonylpentanedioate.
What is the SMILES notation for diethyl 2-nonylpentanedioate?
The canonical SMILES for diethyl 2-nonylpentanedioate is CCCCCCCCCC(CCC(=O)OCC)C(=O)OCC.
What is the InChIKey of diethyl 2-nonylpentanedioate?
The InChIKey is AAIRJZMJWWKTPX-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H34O4/c1-4-7-8-9-10-11-12-13-16(18(20)22-6-3)14-15-17(19)21-5-2/h16H,4-15H2,1-3H3.
What are the key properties of diethyl 2-nonylpentanedioate?
diethyl 2-nonylpentanedioate has a molecular weight of 314.47 g/mol, XLogP of 4.65, 14 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for diethyl 2-nonylpentanedioate is sourced from PubChem (CID 102387144), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).